(3S,5S,8R,9S,10S,13R,14R,17R)-5,13-dimethyl-17-((R)-6-methylheptan-2-yl)-14-(oxiran-2-ylmethyl)-hexadecahydro-1H-cyclopenta[a]phenanthrene-3,10-diol

ID: ALA398686

PubChem CID: 44445107

Max Phase: Preclinical

Molecular Formula: C30H52O3

Molecular Weight: 460.74

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)CCC[C@@H](C)[C@H]1CC[C@@]2(CC3CO3)[C@@H]3CC[C@@]4(C)C[C@@H](O)CC[C@]4(O)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C30H52O3/c1-20(2)7-6-8-21(3)24-12-15-29(18-23-19-33-23)25-10-13-27(4)17-22(31)9-16-30(27,32)26(25)11-14-28(24,29)5/h20-26,31-32H,6-19H2,1-5H3/t21-,22+,23?,24-,25-,26+,27+,28-,29-,30+/m1/s1

Standard InChI Key:  FYBXFTKMXVTULJ-GURYXTELSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  1  0  0  0  0  0999 V2000
    3.7833   -6.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7917   -5.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6458   -6.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0667   -6.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6417   -7.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3542   -6.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5750   -5.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9000   -8.5417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5625   -6.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0833   -5.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7792   -7.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3625   -5.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4917   -7.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9333   -6.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0500   -6.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0625   -7.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3167   -7.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3500   -8.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9333   -8.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6375   -6.1583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8417   -4.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7875   -4.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2208   -6.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2208   -7.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6333   -8.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4958   -8.2208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1958   -5.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6500   -4.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2958   -4.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0042   -5.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5500   -5.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3583   -5.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2833   -6.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3500   -7.3958    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0583   -6.1667    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3708   -5.7292    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  6  1  0
  4  1  1  0
  5  3  1  0
  6  4  1  0
  7  2  1  0
  8 13  1  0
  9  1  1  0
 10  2  1  0
  1 11  1  6
 12 10  1  0
 13 11  1  0
 14  3  1  0
 15  9  1  0
 16  4  1  0
 17 13  1  0
 18 16  1  0
 19  5  1  0
  3 20  1  1
 21  7  1  0
  2 22  1  1
 23 14  1  0
 24 19  1  0
  5 25  1  6
 24 26  1  1
 27 28  1  0
 28 21  1  0
 21 29  1  6
 30 27  1  0
 31 30  1  0
 32 31  1  0
 33 31  1  0
  6 34  1  6
  4 35  1  1
  7 36  1  6
  7 15  1  0
  8 17  1  0
 12  6  1  0
 18  5  1  0
 24 23  1  0
M  END

Associated Targets(non-human)

Cyp51a1 Cytochrome P450 51 (17 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.74Molecular Weight (Monoisotopic): 460.3916AlogP: 6.74#Rotatable Bonds: 7
Polar Surface Area: 52.99Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.28CX LogD: 6.28
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: 2.30

References

1. Jain KS, Kathiravan MK, Somani RS, Shishoo CJ..  (2007)  The biology and chemistry of hyperlipidemia.,  15  (14): [PMID:17521912] [10.1016/j.bmc.2007.04.031]

Source