The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-{[(3,5-dimethoxy-4-methylbenzoyl)(3-phenylpropyl)amino]methyl}phenoxy)-6-methylbenzoic acid ID: ALA3986868
PubChem CID: 134156371
Max Phase: Preclinical
Molecular Formula: C34H35NO6
Molecular Weight: 553.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)N(CCCc2ccccc2)Cc2ccc(Oc3cccc(C)c3C(=O)O)cc2)cc(OC)c1C
Standard InChI: InChI=1S/C34H35NO6/c1-23-10-8-14-29(32(23)34(37)38)41-28-17-15-26(16-18-28)22-35(19-9-13-25-11-6-5-7-12-25)33(36)27-20-30(39-3)24(2)31(21-27)40-4/h5-8,10-12,14-18,20-21H,9,13,19,22H2,1-4H3,(H,37,38)
Standard InChI Key: NFCXAURVAIBLAU-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
15.4633 -17.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4622 -18.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1702 -18.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8799 -18.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8770 -17.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1684 -17.0493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5832 -17.0433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2924 -17.4492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5801 -16.2261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9986 -17.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7079 -17.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4140 -17.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1233 -17.4385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1700 -19.5038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4622 -19.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7555 -17.0497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0479 -17.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1235 -18.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8319 -18.6617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5390 -18.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5333 -17.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8243 -17.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2955 -18.2664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0048 -18.6723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0062 -19.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7146 -19.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4218 -19.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4160 -18.6630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7071 -18.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1315 -19.8894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1357 -20.7065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4279 -21.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4317 -21.9331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1420 -22.3389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8500 -21.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8427 -21.1072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5469 -20.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2580 -21.0952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5400 -19.8755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7541 -18.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5612 -22.3247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
3 14 1 0
14 15 1 0
1 16 1 0
16 17 1 0
13 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 13 1 0
8 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
36 37 1 0
37 38 1 0
37 39 2 0
2 40 1 0
35 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 553.66Molecular Weight (Monoisotopic): 553.2464AlogP: 7.09#Rotatable Bonds: 12Polar Surface Area: 85.30Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.49CX Basic pKa: ┄CX LogP: 7.32CX LogD: 3.95Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.20Np Likeness Score: -0.55
References 1. Terakado M, Suzuki H, Hashimura K, Tanaka M, Ueda H, Kohno H, Fujimoto T, Saga H, Nakade S, Habashita H, Takaoka Y, Seko T.. (2016) Discovery of ONO-7300243 from a Novel Class of Lysophosphatidic Acid Receptor 1 Antagonists: From Hit to Lead., 7 (10): [PMID:27774128 ] [10.1021/acsmedchemlett.6b00225 ]