The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9303033, Y12, Table 23A, Compound 111 ID: ALA3986928
PubChem CID: 137316441
Max Phase: Preclinical
Molecular Formula: C24H25N7O5S
Molecular Weight: 523.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)CCCNC(=O)c1ccc(-c2cc(NC3CC3)n3ncc(/C=C4\NC(=O)NC4=O)c3n2)s1
Standard InChI: InChI=1S/C24H25N7O5S/c1-2-36-20(32)4-3-9-25-23(34)18-8-7-17(37-18)15-11-19(27-14-5-6-14)31-21(28-15)13(12-26-31)10-16-22(33)30-24(35)29-16/h7-8,10-12,14,27H,2-6,9H2,1H3,(H,25,34)(H2,29,30,33,35)/b16-10-
Standard InChI Key: ZIUXKOGDBQYUQZ-YBEGLDIGSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
3.5624 -14.7306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0783 -13.6325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9641 -12.4210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3587 -11.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1657 -10.9183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2445 -9.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6391 -8.4629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5250 -7.2514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9195 -5.8781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8054 -4.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9984 -4.7960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2010 -3.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9531 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9511 -0.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7343 -2.9815 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9792 5.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7246 3.6987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1904 -2.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6588 -2.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7489 -1.9360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.0504 -2.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1450 -2.1900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7433 -4.1499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2521 -4.3116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6493 -5.3493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 21 1 0
19 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 1 0
31 32 2 0
31 33 1 0
33 34 1 0
34 29 1 0
34 35 2 0
27 36 2 0
36 24 1 0
36 37 1 0
37 17 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.58Molecular Weight (Monoisotopic): 523.1638AlogP: 2.29#Rotatable Bonds: 10Polar Surface Area: 155.82Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.24CX Basic pKa: 1.04CX LogP: 0.91CX LogD: 0.53Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.14Np Likeness Score: -1.30
References 1. (2016) Pyrazolopyrimidines and related heterocycles as CK2 inhibitors,