The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9145392, 303 ID: ALA3986943
PubChem CID: 117704716
Max Phase: Preclinical
Molecular Formula: C27H38FN7O
Molecular Weight: 495.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1c(N)ncnc1N1CCC(c2nc(-c3ccc(F)c(C)c3)cn2CCN(CC)CC)CC1
Standard InChI: InChI=1S/C27H38FN7O/c1-5-33(6-2)14-15-35-17-23(21-8-9-22(28)19(4)16-21)32-26(35)20-10-12-34(13-11-20)27-24(36-7-3)25(29)30-18-31-27/h8-9,16-18,20H,5-7,10-15H2,1-4H3,(H2,29,30,31)
Standard InChI Key: GYYUJPVOODOEGB-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
3.6331 -3.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3383 1.3500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2978 -3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2955 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0048 -6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3026 -5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3002 -3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0072 -7.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2234 -8.3576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7644 -9.7857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7356 -9.7904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2036 -8.3653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6274 -7.8989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7458 -8.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1720 -8.4324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2905 -9.4332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4308 -9.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4830 -6.9642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6238 -6.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6504 -10.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1446 -10.9474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9365 -12.2213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2292 -13.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8627 -14.5632 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.7300 -13.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1642 -14.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9381 -12.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 4 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 11 1 0
14 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 17 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 1 0
19 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
32 34 1 0
34 35 1 0
34 36 2 0
36 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.65Molecular Weight (Monoisotopic): 495.3122AlogP: 4.49#Rotatable Bonds: 10Polar Surface Area: 85.33Molecular Species: BASEHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.46CX LogP: 4.64CX LogD: 2.44Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -1.50
References 1. (2015) Imidazole amines as modulators of kinase activity,