The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9303033, G22, Table 37A, Compound 58 ID: ALA3987060
PubChem CID: 136483659
Max Phase: Preclinical
Molecular Formula: C19H17BrN8O2
Molecular Weight: 469.30
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1NC(=O)/C(=C/c2cnn3c(NC4CC4)nc(NCc4ccccc4Br)nc23)N1
Standard InChI: InChI=1S/C19H17BrN8O2/c20-13-4-2-1-3-10(13)8-21-17-25-15-11(7-14-16(29)26-19(30)24-14)9-22-28(15)18(27-17)23-12-5-6-12/h1-4,7,9,12H,5-6,8H2,(H2,21,23,25,27)(H2,24,26,29,30)/b14-7-
Standard InChI Key: FKMGRNJUACTPOT-AUWJEWJLSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
2.8542 -5.8570 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
3.8934 -5.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1924 -6.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -3.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1925 -3.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9792 5.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7246 3.6987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1904 -2.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6588 -2.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7489 -1.9360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.0504 -2.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1450 -2.1900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7433 -4.1499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2521 -4.3116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6493 -5.3493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 14 1 0
12 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
27 22 1 0
27 28 2 0
20 29 2 0
29 17 1 0
29 30 1 0
30 10 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.30Molecular Weight (Monoisotopic): 468.0658AlogP: 2.25#Rotatable Bonds: 6Polar Surface Area: 125.34Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.24CX Basic pKa: 2.31CX LogP: 1.94CX LogD: 1.56Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.32Np Likeness Score: -1.23
References 1. (2016) Pyrazolopyrimidines and related heterocycles as CK2 inhibitors,