US9394289, 32

ID: ALA3987062

PubChem CID: 24874775

Max Phase: Preclinical

Molecular Formula: C25H31N5O3

Molecular Weight: 449.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H]1CC(O)(c2ccc(NC(=O)c3nc(C#N)c[nH]3)c(C3=CCC(C)(C)CC3)n2)C[C@H](C)O1

Standard InChI:  InChI=1S/C25H31N5O3/c1-15-11-25(32,12-16(2)33-15)20-6-5-19(29-23(31)22-27-14-18(13-26)28-22)21(30-20)17-7-9-24(3,4)10-8-17/h5-7,14-16,32H,8-12H2,1-4H3,(H,27,28)(H,29,31)/t15-,16+,25?

Standard InChI Key:  WIYHPJAGCZJKOL-STPAVAKGSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  1  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0531    2.0753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2993    2.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5804    1.4297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8967    2.1490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9319    3.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2504    4.3655    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5311    3.5830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5008    2.3833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8496    4.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1860    3.6473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2156    4.7382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4963    6.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0222    5.7771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7015    4.5466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.8917    4.3931    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6508    4.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3345    3.7096    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6861    5.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0013    6.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0341    8.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7518    8.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8173    9.4807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7116    9.5269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4366    8.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4038    6.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  1  0
  6  7  1  0
  7  8  1  1
  7  9  1  0
  9  2  1  0
  4 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  1  0
 19 22  1  0
 22 23  3  0
 13 24  1  0
 24 25  2  0
 25 10  1  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  1  0
 29 32  1  0
 32 33  1  0
 33 26  1  0
M  END

Associated Targets(non-human)

Csf1r Macrophage colony-stimulating factor 1 receptor (491 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 449.56Molecular Weight (Monoisotopic): 449.2427AlogP: 4.30#Rotatable Bonds: 4
Polar Surface Area: 123.92Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 7.44CX Basic pKa: 3.44CX LogP: 3.51CX LogD: 3.24
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.64Np Likeness Score: 0.05

References

1.  (2016)  Inhibitors of c-fms kinase, 

Source

Source(1):