The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8999981, F48 ID: ALA3987088
PubChem CID: 91970591
Max Phase: Preclinical
Molecular Formula: C28H39N7O3
Molecular Weight: 521.67
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C.C[C@H]1CN(CC2CCOCC2)CCN1C(=O)N1Cc2c(NC(=O)c3ccc(C#N)cc3)n[nH]c2C1(C)C
Standard InChI: InChI=1S/C27H35N7O3.CH4/c1-18-15-32(16-20-8-12-37-13-9-20)10-11-33(18)26(36)34-17-22-23(27(34,2)3)30-31-24(22)29-25(35)21-6-4-19(14-28)5-7-21;/h4-7,18,20H,8-13,15-17H2,1-3H3,(H2,29,30,31,35);1H4/t18-;/m0./s1
Standard InChI Key: IUKQOLDSRDZIRF-FERBBOLQSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
3.5273 -4.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0115 -3.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5028 -3.1320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1081 -1.7595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5998 -1.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2035 -0.2203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6942 -0.0531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2948 1.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4047 2.5288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9141 2.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3135 0.9871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2222 -0.5491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7310 -0.7111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1255 -2.0835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6332 -2.2426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1470 -3.3397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4623 2.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4164 3.9144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1953 5.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3889 5.4088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6849 6.5005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0755 7.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9577 9.0842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4494 8.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0589 7.5562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1767 6.3431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3321 10.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0379 11.1111 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9623 2.7008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4258 1.2743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9414 -0.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2457 -2.1212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7948 3.3436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 6
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 6 1 0
4 12 1 0
12 13 1 0
13 14 1 0
14 2 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 3 0
20 32 2 0
32 33 1 0
33 34 1 0
34 19 2 0
34 35 1 0
35 17 1 0
35 36 1 0
35 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.67Molecular Weight (Monoisotopic): 521.3114AlogP: ┄#Rotatable Bonds: ┄Polar Surface Area: ┄Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: ┄HBA (Lipinski): ┄HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: ┄CX LogD: ┄Aromatic Rings: ┄Heavy Atoms: ┄QED Weighted: ┄Np Likeness Score: ┄
References 1. (2015) 3-amido-pyrrolo[3,4-C]pyrazole-5(1H, 4H,6H) carbaldehyde derivatives,