The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9303033, U36, Table 41A, Compound 7 ID: ALA3987091
PubChem CID: 137316448
Max Phase: Preclinical
Molecular Formula: C21H27N9O3
Molecular Weight: 453.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)N[C@H]1CC[C@H](Nc2nc(NC3CC3)n3ncc(/C=C4\NC(=O)NC4=O)c3n2)CC1
Standard InChI: InChI=1S/C21H27N9O3/c1-2-16(31)23-12-3-5-13(6-4-12)24-19-27-17-11(9-15-18(32)28-21(33)26-15)10-22-30(17)20(29-19)25-14-7-8-14/h9-10,12-14H,2-8H2,1H3,(H,23,31)(H2,24,25,27,29)(H2,26,28,32,33)/b15-9-/t12-,13-
Standard InChI Key: IDQPGNAUNOEMOA-JNZTXQQWSA-N
Molfile:
RDKit 2D
33 37 0 0 1 0 0 0 0 0999 V2000
4.9168 -10.3608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8788 -9.7587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8809 -8.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9211 -7.6596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5826 -7.5048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5847 -6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2883 -5.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2935 -3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8915 -3.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8864 -5.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9792 5.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7246 3.6987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1904 -2.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6588 -2.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7489 -1.9360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.0504 -2.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1450 -2.1900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7433 -4.1499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2521 -4.3116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6493 -5.3493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
6 5 1 6
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 6 1 0
9 12 1 1
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 17 1 0
15 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 2 0
27 29 1 0
29 30 1 0
30 25 1 0
30 31 2 0
23 32 2 0
32 20 1 0
32 33 1 0
33 13 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.51Molecular Weight (Monoisotopic): 453.2237AlogP: 1.13#Rotatable Bonds: 7Polar Surface Area: 154.44Molecular Species: NEUTRALHBA: 9HBD: 5#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.24CX Basic pKa: 2.27CX LogP: 0.27CX LogD: -0.11Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -1.04
References 1. (2016) Pyrazolopyrimidines and related heterocycles as CK2 inhibitors,