The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8487093, 9 ID: ALA3987101
PubChem CID: 91808132
Max Phase: Preclinical
Molecular Formula: C14H18N4O6S
Molecular Weight: 370.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NCc1cc(CC(=O)[C@@H]2CCC3CN2C(=O)N3OS(=O)(=O)O)ccn1
Standard InChI: InChI=1S/C14H18N4O6S/c15-7-10-5-9(3-4-16-10)6-13(19)12-2-1-11-8-17(12)14(20)18(11)24-25(21,22)23/h3-5,11-12H,1-2,6-8,15H2,(H,21,22,23)/t11?,12-/m0/s1
Standard InChI Key: OIDGFWPCKPEZFA-KIYNQFGBSA-N
Molfile:
RDKit 2D
25 27 0 0 1 0 0 0 0 0999 V2000
8.1582 5.1521 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5900 4.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0899 4.0487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3777 2.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8783 2.6852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1630 1.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6628 1.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0348 2.3471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9488 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8975 -0.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6421 0.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0947 1.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8393 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8063 -1.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6902 -2.1435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6568 -0.6386 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4080 -1.7063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0178 -3.1555 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.8648 -4.0056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1417 -3.4643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2947 -4.3141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0911 3.9621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8033 5.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3027 5.3256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
9 7 1 6
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 9 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 12 1 0
17 18 1 0
18 19 1 0
19 20 2 0
19 21 2 0
19 22 1 0
5 23 2 0
23 24 1 0
24 25 2 0
25 3 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 370.39Molecular Weight (Monoisotopic): 370.0947AlogP: -0.35#Rotatable Bonds: 6Polar Surface Area: 143.13Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: -2.06CX Basic pKa: 8.09CX LogP: -1.81CX LogD: -1.89Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.65Np Likeness Score: -0.33
References 1. (2013) Œ=-lactamase inhibitors,