US9475795, 109

ID: ALA3987113

PubChem CID: 86704308

Max Phase: Preclinical

Molecular Formula: C19H26ClN3O3S

Molecular Weight: 411.95

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COCC(c1ccc(Cl)cc1)C1CCN(S(=O)(=O)c2c(C)n[nH]c2C)CC1

Standard InChI:  InChI=1S/C19H26ClN3O3S/c1-13-19(14(2)22-21-13)27(24,25)23-10-8-16(9-11-23)18(12-26-3)15-4-6-17(20)7-5-15/h4-7,16,18H,8-12H2,1-3H3,(H,21,22)

Standard InChI Key:  AZYYSNBRKYPRHK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    3.8920   -4.9577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8934   -3.7577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5949   -3.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5966   -1.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5988    1.5004    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6378    0.9001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5986    0.3004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5998    3.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8138    3.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9526    3.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3512    5.2871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8512    5.2880    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3868    3.8617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2475    3.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9042    0.7419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2058    1.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5023    0.7331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5436    1.3296    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.4972   -0.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1956   -1.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10  5  1  0
  8 11  1  0
 11 12  2  0
 11 13  2  0
 11 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 17 18  1  0
 18 19  1  0
 19 14  2  0
 19 20  1  0
  4 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 24 26  1  0
 26 27  2  0
 27 21  1  0
M  END

Associated Targets(Human)

PROKR1 Tchem Prokineticin receptor 1 (175 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.95Molecular Weight (Monoisotopic): 411.1383AlogP: 3.51#Rotatable Bonds: 6
Polar Surface Area: 75.29Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.99CX Basic pKa: 2.62CX LogP: 2.55CX LogD: 2.55
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.79Np Likeness Score: -1.59

References

1.  (2016)  Sulfonyl piperidine derivatives and their use for treating prokineticin mediated diseases, 

Source

Source(1):