US9255090, 402

ID: ALA3987165

PubChem CID: 89648881

Max Phase: Preclinical

Molecular Formula: C27H24ClF2NO5

Molecular Weight: 515.94

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOc1ccc(CC(=O)O)cc1-c1ccc(F)c2c1CN(C(=O)OCc1cc(Cl)ccc1F)CC2

Standard InChI:  InChI=1S/C27H24ClF2NO5/c1-2-35-25-8-3-16(12-26(32)33)11-21(25)19-5-7-24(30)20-9-10-31(14-22(19)20)27(34)36-15-17-13-18(28)4-6-23(17)29/h3-8,11,13H,2,9-10,12,14-15H2,1H3,(H,32,33)

Standard InChI Key:  PUHNTUAAKKMCET-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    5.2110    2.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2066    1.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9046    0.7483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8888   -5.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5868   -5.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5825   -7.1998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5496   -5.3964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2959   -5.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3341   -5.8527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0049   -5.9994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0080   -7.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3088   -8.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6053   -7.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9070   -8.2398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9441   -7.6362    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.9122   -9.7398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6157  -10.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3141   -9.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2770  -10.3524    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
  7 12  1  0
 12 13  2  0
 13  4  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 14  1  0
 24 19  2  0
 22 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 33 34  1  0
 34 35  2  0
 35 29  1  0
 35 36  1  0
M  END

Associated Targets(Human)

PTGDR2 Tchem G protein-coupled receptor 44 (4688 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 515.94Molecular Weight (Monoisotopic): 515.1311AlogP: 6.01#Rotatable Bonds: 7
Polar Surface Area: 76.07Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.25CX Basic pKa: CX LogP: 5.90CX LogD: 2.90
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.42Np Likeness Score: -0.94

References

1.  (2016)  Heterocyclyl derivatives and their use as prostaglandin D2 receptor modulators, 

Source

Source(1):