1-(3',3'-diphenylpropyl)-4-[2'-(2'',4''-dichlorophenyl)ethyl]-7-[N-(aminocarbonylmethyl)-N-(cyclopropyl)aminocarbonyl]perhydro-1,4-diazepine-2,5-dione

ID: ALA400524

PubChem CID: 24777789

Max Phase: Preclinical

Molecular Formula: C34H36Cl2N4O4

Molecular Weight: 635.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)CN(C(=O)C1CC(=O)N(CCc2ccc(Cl)cc2Cl)CC(=O)N1CCC(c1ccccc1)c1ccccc1)C1CC1

Standard InChI:  InChI=1S/C34H36Cl2N4O4/c35-26-12-11-25(29(36)19-26)15-17-38-22-33(43)39(30(20-32(38)42)34(44)40(21-31(37)41)27-13-14-27)18-16-28(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-12,19,27-28,30H,13-18,20-22H2,(H2,37,41)

Standard InChI Key:  XCEXVKUAXLXVKS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 44 48  0  0  0  0  0  0  0  0999 V2000
    0.1567  -10.3610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9012  -10.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6426  -10.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0361  -11.1651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8210  -11.1849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4728  -11.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2987  -11.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4821   -9.8388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8423  -11.3403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3971  -10.7298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2033  -10.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7556  -10.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5611  -10.4666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8131  -11.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2534  -11.8650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4500  -11.6871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6490  -12.5690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6235  -11.3763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8589  -12.1670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6614  -12.3585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8968  -13.1491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2284  -11.7592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3286  -13.7442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5635  -14.5342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3667  -14.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9348  -14.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6969  -13.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0306  -11.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5974  -11.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3621  -10.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5549  -10.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9916  -10.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2918   -9.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0573  -10.1791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1754   -9.0548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8245   -8.5456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4099   -8.7472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8928  -12.2955    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -4.6191  -11.4294    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.5900   -8.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2391   -8.3440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7064   -9.6700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9005   -8.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5929   -8.8659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
 20 22  1  0
 10 11  1  0
 21 23  2  0
  4  6  1  0
 23 24  1  0
 11 12  2  0
 24 25  2  0
  1  2  1  0
 25 26  1  0
 12 13  1  0
 26 27  2  0
 27 21  1  0
  5  7  1  0
 22 28  2  0
 13 14  2  0
 28 29  1  0
  6  7  1  0
 29 30  2  0
 14 15  1  0
 30 31  1  0
  1  4  1  0
 31 32  2  0
 32 22  1  0
 15 16  2  0
  3 33  1  0
 16 11  1  0
 33 34  2  0
  1  8  2  0
 33 35  1  0
  7 17  2  0
 35 36  1  0
 35 37  1  0
  5 18  1  0
 16 38  1  0
  4  9  1  0
 14 39  1  0
 18 19  1  0
 36 40  1  0
  3  5  1  0
 40 41  1  0
 19 20  1  0
 40 42  2  0
 43 37  1  0
 44 43  1  0
 37 44  1  0
  9 10  1  0
 20 21  1  0
M  END

Associated Targets(Human)

SAOS-2 (672 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 635.59Molecular Weight (Monoisotopic): 634.2114AlogP: 4.66#Rotatable Bonds: 12
Polar Surface Area: 104.02Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.04CX LogD: 4.04
Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.31Np Likeness Score: -1.00

References

1. Mondragón L, Orzáez M, Sanclimens G, Moure A, Armiñán A, Sepúlveda P, Messeguer A, Vicent MJ, Pérez-Payá E..  (2008)  Modulation of cellular apoptosis with apoptotic protease-activating factor 1 (Apaf-1) inhibitors.,  51  (3): [PMID:18197610] [10.1021/jm701195j]

Source