The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3',3'-diphenylpropyl)-4-[2'-(2'',4''-dichlorophenyl)ethyl]-7-[N-(aminocarbonylmethyl)-N-(cyclopropyl)aminocarbonyl]perhydro-1,4-diazepine-2,5-dione ID: ALA400524
PubChem CID: 24777789
Max Phase: Preclinical
Molecular Formula: C34H36Cl2N4O4
Molecular Weight: 635.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)CN(C(=O)C1CC(=O)N(CCc2ccc(Cl)cc2Cl)CC(=O)N1CCC(c1ccccc1)c1ccccc1)C1CC1
Standard InChI: InChI=1S/C34H36Cl2N4O4/c35-26-12-11-25(29(36)19-26)15-17-38-22-33(43)39(30(20-32(38)42)34(44)40(21-31(37)41)27-13-14-27)18-16-28(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-12,19,27-28,30H,13-18,20-22H2,(H2,37,41)
Standard InChI Key: XCEXVKUAXLXVKS-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
0.1567 -10.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9012 -10.0146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6426 -10.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0361 -11.1651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8210 -11.1849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4728 -11.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2987 -11.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4821 -9.8388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8423 -11.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3971 -10.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2033 -10.9050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7556 -10.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5611 -10.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8131 -11.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2534 -11.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4500 -11.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6490 -12.5690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6235 -11.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8589 -12.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6614 -12.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8968 -13.1491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2284 -11.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3286 -13.7442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5635 -14.5342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3667 -14.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9348 -14.1221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6969 -13.3344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0306 -11.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5974 -11.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3621 -10.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5549 -10.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9916 -10.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2918 -9.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0573 -10.1791 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1754 -9.0548 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8245 -8.5456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4099 -8.7472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8928 -12.2955 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.6191 -11.4294 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.5900 -8.8532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2391 -8.3440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7064 -9.6700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9005 -8.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5929 -8.8659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
20 22 1 0
10 11 1 0
21 23 2 0
4 6 1 0
23 24 1 0
11 12 2 0
24 25 2 0
1 2 1 0
25 26 1 0
12 13 1 0
26 27 2 0
27 21 1 0
5 7 1 0
22 28 2 0
13 14 2 0
28 29 1 0
6 7 1 0
29 30 2 0
14 15 1 0
30 31 1 0
1 4 1 0
31 32 2 0
32 22 1 0
15 16 2 0
3 33 1 0
16 11 1 0
33 34 2 0
1 8 2 0
33 35 1 0
7 17 2 0
35 36 1 0
35 37 1 0
5 18 1 0
16 38 1 0
4 9 1 0
14 39 1 0
18 19 1 0
36 40 1 0
3 5 1 0
40 41 1 0
19 20 1 0
40 42 2 0
43 37 1 0
44 43 1 0
37 44 1 0
9 10 1 0
20 21 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 635.59Molecular Weight (Monoisotopic): 634.2114AlogP: 4.66#Rotatable Bonds: 12Polar Surface Area: 104.02Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.04CX LogD: 4.04Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.31Np Likeness Score: -1.00
References 1. Mondragón L, Orzáez M, Sanclimens G, Moure A, Armiñán A, Sepúlveda P, Messeguer A, Vicent MJ, Pérez-Payá E.. (2008) Modulation of cellular apoptosis with apoptotic protease-activating factor 1 (Apaf-1) inhibitors., 51 (3): [PMID:18197610 ] [10.1021/jm701195j ]