The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3',3'-diphenylpropyl)-4-[2'-(2'',4''-dichlorophenyl)ethyl]-7-[N-(aminocarbonylmethyl)-N-(butyl)aminocarbonyl]perhydro-1,4-diazepine-2,5-dione ID: ALA400525
PubChem CID: 16112819
Max Phase: Preclinical
Molecular Formula: C35H40Cl2N4O4
Molecular Weight: 651.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCN(CC(N)=O)C(=O)C1CC(=O)N(CCc2ccc(Cl)cc2Cl)CC(=O)N1CCC(c1ccccc1)c1ccccc1
Standard InChI: InChI=1S/C35H40Cl2N4O4/c1-2-3-18-40(23-32(38)42)35(45)31-22-33(43)39(19-16-27-14-15-28(36)21-30(27)37)24-34(44)41(31)20-17-29(25-10-6-4-7-11-25)26-12-8-5-9-13-26/h4-15,21,29,31H,2-3,16-20,22-24H2,1H3,(H2,38,42)
Standard InChI Key: UYEVKNMLLONDTG-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 48 0 0 0 0 0 0 0 0999 V2000
13.9233 -11.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6679 -11.0146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4093 -11.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7306 -12.1651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5876 -12.1849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2394 -12.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0654 -12.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2846 -10.8388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9244 -12.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3695 -11.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5634 -11.9050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0111 -11.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2056 -11.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9535 -12.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5132 -12.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3167 -12.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4157 -13.5690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3901 -12.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6256 -13.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4281 -13.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6635 -14.1491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9951 -12.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0953 -14.7442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3302 -15.5342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1334 -15.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7014 -15.1221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4635 -14.3344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7973 -12.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3641 -12.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1288 -11.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3215 -11.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7583 -11.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0584 -10.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8239 -11.1791 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9420 -10.0548 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5912 -9.5456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1765 -9.7472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0601 -8.9305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2946 -8.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1793 -7.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8739 -13.2955 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.1476 -12.4294 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17.3567 -9.8532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0058 -9.3440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4731 -10.6700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20 22 1 0
10 11 1 0
21 23 2 0
4 6 1 0
23 24 1 0
11 12 2 0
24 25 2 0
1 2 1 0
25 26 1 0
12 13 1 0
26 27 2 0
27 21 1 0
5 7 1 0
22 28 2 0
13 14 2 0
28 29 1 0
6 7 1 0
29 30 2 0
14 15 1 0
30 31 1 0
1 4 1 0
31 32 2 0
32 22 1 0
15 16 2 0
3 33 1 0
16 11 1 0
33 34 2 0
1 8 2 0
33 35 1 0
7 17 2 0
35 36 1 0
35 37 1 0
5 18 1 0
37 38 1 0
4 9 1 0
38 39 1 0
18 19 1 0
39 40 1 0
3 5 1 0
16 41 1 0
19 20 1 0
14 42 1 0
9 10 1 0
36 43 1 0
20 21 1 0
43 44 1 0
2 3 1 0
43 45 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 651.63Molecular Weight (Monoisotopic): 650.2427AlogP: 5.30#Rotatable Bonds: 14Polar Surface Area: 104.02Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.90CX LogD: 4.90Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.26Np Likeness Score: -0.94
References 1. Mondragón L, Orzáez M, Sanclimens G, Moure A, Armiñán A, Sepúlveda P, Messeguer A, Vicent MJ, Pérez-Payá E.. (2008) Modulation of cellular apoptosis with apoptotic protease-activating factor 1 (Apaf-1) inhibitors., 51 (3): [PMID:18197610 ] [10.1021/jm701195j ]