1-(3',3'-diphenylpropyl)-4-[2'-(2'',4''-dichlorophenyl)ethyl]-7-[N-(aminocarbonylmethyl)-N-(butyl)aminocarbonyl]perhydro-1,4-diazepine-2,5-dione

ID: ALA400525

PubChem CID: 16112819

Max Phase: Preclinical

Molecular Formula: C35H40Cl2N4O4

Molecular Weight: 651.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCN(CC(N)=O)C(=O)C1CC(=O)N(CCc2ccc(Cl)cc2Cl)CC(=O)N1CCC(c1ccccc1)c1ccccc1

Standard InChI:  InChI=1S/C35H40Cl2N4O4/c1-2-3-18-40(23-32(38)42)35(45)31-22-33(43)39(19-16-27-14-15-28(36)21-30(27)37)24-34(44)41(31)20-17-29(25-10-6-4-7-11-25)26-12-8-5-9-13-26/h4-15,21,29,31H,2-3,16-20,22-24H2,1H3,(H2,38,42)

Standard InChI Key:  UYEVKNMLLONDTG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 45 48  0  0  0  0  0  0  0  0999 V2000
   13.9233  -11.3610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6679  -11.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4093  -11.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7306  -12.1651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5876  -12.1849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2394  -12.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0654  -12.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2846  -10.8388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9244  -12.3403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3695  -11.7298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5634  -11.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0111  -11.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2056  -11.4666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9535  -12.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5132  -12.8650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3167  -12.6871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4157  -13.5690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3901  -12.3763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6256  -13.1670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4281  -13.3585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6635  -14.1491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9951  -12.7592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0953  -14.7442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3302  -15.5342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1334  -15.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7014  -15.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4635  -14.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7973  -12.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3641  -12.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1288  -11.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3215  -11.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7583  -11.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0584  -10.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8239  -11.1791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9420  -10.0548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5912   -9.5456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1765   -9.7472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0601   -8.9305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2946   -8.6229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1793   -7.8028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8739  -13.2955    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.1476  -12.4294    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.3567   -9.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0058   -9.3440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4731  -10.6700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 20 22  1  0
 10 11  1  0
 21 23  2  0
  4  6  1  0
 23 24  1  0
 11 12  2  0
 24 25  2  0
  1  2  1  0
 25 26  1  0
 12 13  1  0
 26 27  2  0
 27 21  1  0
  5  7  1  0
 22 28  2  0
 13 14  2  0
 28 29  1  0
  6  7  1  0
 29 30  2  0
 14 15  1  0
 30 31  1  0
  1  4  1  0
 31 32  2  0
 32 22  1  0
 15 16  2  0
  3 33  1  0
 16 11  1  0
 33 34  2  0
  1  8  2  0
 33 35  1  0
  7 17  2  0
 35 36  1  0
 35 37  1  0
  5 18  1  0
 37 38  1  0
  4  9  1  0
 38 39  1  0
 18 19  1  0
 39 40  1  0
  3  5  1  0
 16 41  1  0
 19 20  1  0
 14 42  1  0
  9 10  1  0
 36 43  1  0
 20 21  1  0
 43 44  1  0
  2  3  1  0
 43 45  2  0
M  END

Associated Targets(Human)

SAOS-2 (672 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 651.63Molecular Weight (Monoisotopic): 650.2427AlogP: 5.30#Rotatable Bonds: 14
Polar Surface Area: 104.02Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 4.90CX LogD: 4.90
Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.26Np Likeness Score: -0.94

References

1. Mondragón L, Orzáez M, Sanclimens G, Moure A, Armiñán A, Sepúlveda P, Messeguer A, Vicent MJ, Pérez-Payá E..  (2008)  Modulation of cellular apoptosis with apoptotic protease-activating factor 1 (Apaf-1) inhibitors.,  51  (3): [PMID:18197610] [10.1021/jm701195j]

Source