The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2-(2-fluoro-4-(2-oxopyridin-1(2H)-yl)phenyl)acetyl)-1-(4-methoxyphenyl)-1H-pyrazole-3-carboxamide ID: ALA403042
PubChem CID: 10275412
Max Phase: Preclinical
Molecular Formula: C24H19FN4O4
Molecular Weight: 446.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-n2nc(C(N)=O)cc2C(=O)Cc2ccc(-n3ccccc3=O)cc2F)cc1
Standard InChI: InChI=1S/C24H19FN4O4/c1-33-18-9-7-16(8-10-18)29-21(14-20(27-29)24(26)32)22(30)12-15-5-6-17(13-19(15)25)28-11-3-2-4-23(28)31/h2-11,13-14H,12H2,1H3,(H2,26,32)
Standard InChI Key: MRPLIGSOQUCMBC-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
3.4422 -7.8617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1096 -8.3470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7823 -7.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5136 -7.0788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6938 -7.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1105 -9.1722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3965 -9.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3971 -10.4050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8251 -9.5769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8292 -10.3998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1137 -10.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5001 -8.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5084 -9.0866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2105 -7.8416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9292 -8.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9343 -9.0719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6522 -9.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3636 -9.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3525 -8.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6341 -7.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0829 -9.4618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0883 -10.2862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8035 -10.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5158 -10.2734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5084 -9.4472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7885 -9.0384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7788 -8.2133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6225 -7.0013 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.2081 -6.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5429 -5.6560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3875 -6.4972 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1162 -11.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4029 -12.0608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 16 2 0
7 8 1 0
16 17 1 0
8 11 2 0
17 18 2 0
3 4 2 0
18 19 1 0
10 9 2 0
19 20 2 0
20 15 1 0
9 6 1 0
18 21 1 0
21 22 1 0
10 11 1 0
4 5 1 0
5 1 2 0
1 2 1 0
3 12 1 0
21 26 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
2 6 1 0
26 27 2 0
12 13 2 0
20 28 1 0
5 29 1 0
12 14 1 0
29 30 2 0
6 7 2 0
29 31 1 0
14 15 1 0
11 32 1 0
2 3 1 0
32 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.44Molecular Weight (Monoisotopic): 446.1390AlogP: 2.70#Rotatable Bonds: 7Polar Surface Area: 109.21Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.24CX Basic pKa: ┄CX LogP: 2.52CX LogD: 2.52Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.44Np Likeness Score: -1.39
References 1. Varnes JG, Wacker DA, Pinto DJ, Orwat MJ, Theroff JP, Wells B, Galemo RA, Luettgen JM, Knabb RM, Bai S, He K, Lam PY, Wexler RR.. (2008) Structure-activity relationship and pharmacokinetic profile of 5-ketopyrazole factor Xa inhibitors., 18 (2): [PMID:18054227 ] [10.1016/j.bmcl.2007.11.040 ]