The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[4-(Tetrahydro-2H-pyran-4-yl)piperazin-1-yl]benzyl-N-carbamimidoylcarbamate (2R,3R)-tartrate ID: ALA4059565
PubChem CID: 146029984
Max Phase: Preclinical
Molecular Formula: C22H33N5O9
Molecular Weight: 361.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NC(=O)OCc1cccc(N2CCN(C3CCOCC3)CC2)c1.O=C(O)[C@H](O)[C@@H](O)C(=O)O
Standard InChI: InChI=1S/C18H27N5O3.C4H6O6/c19-17(20)21-18(24)26-13-14-2-1-3-16(12-14)23-8-6-22(7-9-23)15-4-10-25-11-5-15;5-1(3(7)8)2(6)4(9)10/h1-3,12,15H,4-11,13H2,(H4,19,20,21,24);1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1
Standard InChI Key: VTOGAJYLOQWSEY-LREBCSMRSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
10.1320 -12.8739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8411 -11.6440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5501 -13.6953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8411 -12.4653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5501 -12.8739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2634 -12.4653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1320 -13.6953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4187 -12.4653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2634 -11.6440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9725 -12.8739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6754 -10.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3845 -9.8620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6754 -11.0878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9705 -9.8620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0936 -10.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8027 -9.8620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0936 -11.0878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2614 -10.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5523 -9.8620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8473 -10.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1382 -9.8620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1382 -9.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8473 -8.6362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5523 -9.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4291 -10.2706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4291 -11.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7242 -11.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0151 -11.0878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0151 -10.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7242 -9.8620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8920 -11.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6010 -11.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3060 -11.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3060 -12.3136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6010 -12.7222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8920 -12.3136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 4 1 0
4 2 1 6
4 5 1 0
5 3 1 6
5 6 1 0
1 7 2 0
1 8 1 0
6 9 2 0
6 10 1 0
11 12 1 0
11 13 2 0
11 14 1 0
15 16 1 0
15 17 2 0
12 15 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
19 24 2 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
25 30 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
31 36 1 0
28 33 1 0
21 25 1 0
14 18 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 361.45Molecular Weight (Monoisotopic): 361.2114AlogP: 1.11#Rotatable Bonds: 4Polar Surface Area: 103.91Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.32CX Basic pKa: 8.76CX LogP: 0.78CX LogD: -1.03Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.55Np Likeness Score: -1.04
References 1. Yamaki S, Yamada H, Nagashima A, Kondo M, Shimada Y, Kadono K, Yoshihara K.. (2017) Synthesis and structure activity relationships of carbamimidoylcarbamate derivatives as novel vascular adhesion protein-1 inhibitors., 25 (21): [PMID:28988626 ] [10.1016/j.bmc.2017.09.036 ]