The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-{2-[(2R)-2-(Hydroxymethyl)pyrrolidin-1-yl]pyrimidin-5-yl}benzyl)-N-methylglycinamide dihydrochloride ID: ALA4059576
PubChem CID: 137634929
Max Phase: Preclinical
Molecular Formula: C19H27Cl2N5O2
Molecular Weight: 355.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(CC(N)=O)Cc1cccc(-c2cnc(N3CCC[C@@H]3CO)nc2)c1.Cl.Cl
Standard InChI: InChI=1S/C19H25N5O2.2ClH/c1-23(12-18(20)26)11-14-4-2-5-15(8-14)16-9-21-19(22-10-16)24-7-3-6-17(24)13-25;;/h2,4-5,8-10,17,25H,3,6-7,11-13H2,1H3,(H2,20,26);2*1H/t17-;;/m1../s1
Standard InChI Key: BFILLIIJBSZIRD-ZEECNFPPSA-N
Molfile:
RDKit 2D
28 28 0 0 0 0 0 0 0 0999 V2000
10.9899 -11.8800 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.2138 -8.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5160 -9.6738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5085 -8.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2104 -7.6285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9266 -8.8477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8107 -10.0889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1020 -9.6827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3967 -10.0978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6839 -9.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6805 -8.8744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3858 -8.4635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0945 -8.8655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5680 -10.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5646 -10.1156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2699 -9.7005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9786 -10.1067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9861 -10.9239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2767 -11.3349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8627 -11.3438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2247 -10.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1125 -11.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5688 -11.6248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9798 -12.3301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7775 -12.1571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3860 -12.7025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2179 -13.5022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9628 -11.9143 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
2 4 1 0
2 5 2 0
2 6 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
8 13 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
14 20 1 0
10 17 1 0
3 7 1 0
3 21 1 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 20 1 0
25 26 1 1
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 355.44Molecular Weight (Monoisotopic): 355.2008AlogP: 1.02#Rotatable Bonds: 7Polar Surface Area: 95.58Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.29CX LogP: 0.87CX LogD: 0.62Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.77Np Likeness Score: -1.15
References 1. Yamaki S, Koga Y, Nagashima A, Kondo M, Shimada Y, Kadono K, Moritomo A, Yoshihara K.. (2017) Synthesis and pharmacological evaluation of glycine amide derivatives as novel vascular adhesion protein-1 inhibitors without CYP3A4 and CYP2C19 inhibition., 25 (15): [PMID:28601507 ] [10.1016/j.bmc.2017.05.059 ]