The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(cis-3,5-Dimethylpiperidin-1-yl)propyl)-1-((2-(4-fluoro-3-methylphenyl)oxazol-4-yl)methyl)piperidine-4-carboxamide ID: ALA4059630
PubChem CID: 72793928
Max Phase: Preclinical
Molecular Formula: C27H39FN4O2
Molecular Weight: 470.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(-c2nc(CN3CCC(C(=O)NCCCN4C[C@H](C)C[C@H](C)C4)CC3)co2)ccc1F
Standard InChI: InChI=1S/C27H39FN4O2/c1-19-13-20(2)16-32(15-19)10-4-9-29-26(33)22-7-11-31(12-8-22)17-24-18-34-27(30-24)23-5-6-25(28)21(3)14-23/h5-6,14,18-20,22H,4,7-13,15-17H2,1-3H3,(H,29,33)/t19-,20+
Standard InChI Key: GUCPCTHHCYQSTE-BGYRXZFFSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
10.9367 -9.5762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6458 -9.1676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3508 -9.5762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3508 -10.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6458 -10.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9367 -10.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0598 -10.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0598 -11.6192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7648 -10.3934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2276 -9.1676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7085 -10.6436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2652 -9.9560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7803 -9.3198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5441 -9.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5000 -10.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4497 -9.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0065 -10.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1869 -10.5553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8188 -9.8276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2620 -9.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0775 -9.1842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7437 -11.2429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0033 -9.7876 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.4739 -10.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1830 -10.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8921 -10.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5970 -10.3934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5970 -9.5762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3061 -9.1676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0152 -9.5762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0152 -10.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3061 -10.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7202 -10.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3061 -8.3504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
7 8 2 0
7 9 1 0
4 7 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
11 15 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
18 22 1 0
19 23 1 0
12 16 1 0
10 14 1 0
1 10 1 0
24 25 1 0
25 26 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
27 32 1 0
31 33 1 6
29 34 1 6
26 27 1 0
9 24 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.63Molecular Weight (Monoisotopic): 470.3057AlogP: 4.49#Rotatable Bonds: 8Polar Surface Area: 61.61Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.81CX LogP: 3.77CX LogD: 1.16Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.58Np Likeness Score: -1.89
References 1. He S, Li K, Lin B, Hu Z, Xiao J, Hu X, Wang AQ, Xu X, Ferrer M, Southall N, Zheng W, Aubé J, Schoenen FJ, Marugan JJ, Liang TJ, Frankowski KJ.. (2017) Development of an Aryloxazole Class of Hepatitis C Virus Inhibitors Targeting the Entry Stage of the Viral Replication Cycle., 60 (14): [PMID:28636348 ] [10.1021/acs.jmedchem.7b00561 ]