The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5beta-cholan-24-oyl)-L-beta-homo-tryptophan ID: ALA4059908
PubChem CID: 137637448
Max Phase: Preclinical
Molecular Formula: C36H52N2O3
Molecular Weight: 560.82
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](CCC(=O)N[C@H](CC(=O)O)Cc1c[nH]c2ccccc12)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CCCC[C@]4(C)[C@H]3CC[C@]12C
Standard InChI: InChI=1S/C36H52N2O3/c1-23(11-16-33(39)38-26(21-34(40)41)20-24-22-37-32-10-5-4-9-27(24)32)29-14-15-30-28-13-12-25-8-6-7-18-35(25,2)31(28)17-19-36(29,30)3/h4-5,9-10,22-23,25-26,28-31,37H,6-8,11-21H2,1-3H3,(H,38,39)(H,40,41)/t23-,25+,26+,28+,29-,30+,31+,35+,36-/m1/s1
Standard InChI Key: WCINYUWYVYOZNR-MAAFBQBVSA-N
Molfile:
RDKit 2D
46 51 0 0 0 0 0 0 0 0999 V2000
28.6141 -10.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6141 -11.7832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3194 -12.1877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3194 -10.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0246 -10.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0257 -11.7832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7300 -12.1887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4378 -11.7814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7279 -10.5543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4387 -10.9649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4374 -9.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7242 -9.7357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1482 -9.7367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1451 -10.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9255 -10.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4110 -10.1523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9305 -9.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0173 -10.1489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0215 -12.5963 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
30.7231 -11.3705 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
31.4330 -10.1447 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
32.1387 -11.3746 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
32.1429 -8.9189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1860 -8.7096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9859 -8.5427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6414 -8.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5305 -9.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3304 -8.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5859 -8.2089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7153 -9.2698 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
35.8750 -9.5945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6749 -9.4276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9304 -8.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7303 -8.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9858 -7.7082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.2749 -9.0937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.2194 -10.0369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9640 -10.8131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1864 -11.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1834 -11.8795 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.4424 -11.4756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9590 -12.1311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2851 -12.8753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0943 -12.9653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5763 -12.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2476 -11.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
9 12 1 0
10 14 1 0
13 11 1 0
11 12 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
5 18 1 1
6 19 1 1
9 20 1 6
10 21 1 1
14 22 1 6
13 23 1 1
17 24 1 0
24 25 1 0
24 26 1 6
25 27 1 0
27 28 1 0
28 29 2 0
17 30 1 6
28 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
34 36 1 0
32 37 1 6
37 38 1 0
38 39 2 0
39 40 1 0
40 42 1 0
41 38 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 560.82Molecular Weight (Monoisotopic): 560.3978AlogP: 8.14#Rotatable Bonds: 9Polar Surface Area: 82.19Molecular Species: ACIDHBA: 2HBD: 3#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.57CX Basic pKa: ┄CX LogP: 7.71CX LogD: 4.96Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.29Np Likeness Score: 1.22
References 1. Incerti M, Russo S, Callegari D, Pala D, Giorgio C, Zanotti I, Barocelli E, Vicini P, Vacondio F, Rivara S, Castelli R, Tognolini M, Lodola A.. (2017) Metadynamics for Perspective Drug Design: Computationally Driven Synthesis of New Protein-Protein Interaction Inhibitors Targeting the EphA2 Receptor., 60 (2): [PMID:28005388 ] [10.1021/acs.jmedchem.6b01642 ] 2. Lodola A, Giorgio C, Incerti M, Zanotti I, Tognolini M.. (2017) Targeting Eph/ephrin system in cancer therapy., 142 [PMID:28780190 ] [10.1016/j.ejmech.2017.07.029 ]