8,8'-Disulfanediylbis(N-(2-morpholinoethyl)quinoline-3-carboxamide)

ID: ALA4059915

PubChem CID: 126599607

Max Phase: Preclinical

Molecular Formula: C32H36N6O4S2

Molecular Weight: 632.81

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCCN1CCOCC1)c1cnc2c(SSc3cccc4cc(C(=O)NCCN5CCOCC5)cnc34)cccc2c1

Standard InChI:  InChI=1S/C32H36N6O4S2/c39-31(33-7-9-37-11-15-41-16-12-37)25-19-23-3-1-5-27(29(23)35-21-25)43-44-28-6-2-4-24-20-26(22-36-30(24)28)32(40)34-8-10-38-13-17-42-18-14-38/h1-6,19-22H,7-18H2,(H,33,39)(H,34,40)

Standard InChI Key:  VQRDUTCTXDMOFP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 44 49  0  0  0  0  0  0  0  0999 V2000
   23.7178  -16.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7166  -17.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4247  -17.8942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4229  -16.2568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1315  -16.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1323  -17.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8408  -17.8882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.5491  -17.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5443  -16.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8352  -16.2519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4266  -18.7114    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.7198  -19.1216    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.7217  -19.9388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7223  -21.5692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4314  -21.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4263  -20.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0131  -21.1614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0122  -20.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3090  -19.9447    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.6062  -20.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6110  -21.1684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3148  -21.5686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2495  -16.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9597  -16.6466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2446  -15.4252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9058  -21.5814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1956  -21.1773    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9109  -22.3986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6649  -16.2337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4904  -21.5903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7802  -21.1861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3751  -16.6380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0814  -21.5996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.0737  -16.2245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3779  -21.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6811  -21.6061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6856  -22.4185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3930  -22.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0959  -22.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7792  -16.6273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4758  -16.2172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4711  -15.4051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.7638  -15.0047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0612  -15.4164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  3 11  1  0
 11 12  1  0
 12 13  1  0
 13 18  2  0
 17 14  2  0
 14 15  1  0
 15 16  2  0
 16 13  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  9 23  1  0
 23 24  1  0
 23 25  2  0
 21 26  1  0
 26 27  1  0
 26 28  2  0
 24 29  1  0
 27 30  1  0
 30 31  1  0
 29 32  1  0
 33 31  1  0
 34 32  1  0
 33 35  1  0
 33 39  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 34 40  1  0
 34 44  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 43 44  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4059915

    ---

Associated Targets(Human)

PSMD14 Tchem 26S proteasome non-ATPase regulatory subunit 14 (475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
COPS5 Tchem COP9 signalosome complex subunit 5 (35 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
STAMBP Tchem STAM-binding protein (28 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 632.81Molecular Weight (Monoisotopic): 632.2239AlogP: 3.71#Rotatable Bonds: 11
Polar Surface Area: 108.92Molecular Species: NEUTRALHBA: 10HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.79CX Basic pKa: 6.21CX LogP: 2.64CX LogD: 2.61
Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.24Np Likeness Score: -0.94

References

1. Perez C, Li J, Parlati F, Rouffet M, Ma Y, Mackinnon AL, Chou TF, Deshaies RJ, Cohen SM..  (2017)  Discovery of an Inhibitor of the Proteasome Subunit Rpn11.,  60  (4): [PMID:28191850] [10.1021/acs.jmedchem.6b01379]
2. Perez, Christian C and 8 more authors.  2017-02-23  Discovery of an Inhibitor of the Proteasome Subunit Rpn11.  [PMID:28191850]

Source