The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(Butylamino)-2-oxoethyl)-4-(dimethylamino)-N-(6-(hydroxyamino)-6-oxohexyl)-benzamide ID: ALA4059953
PubChem CID: 137635601
Max Phase: Preclinical
Molecular Formula: C21H34N4O4
Molecular Weight: 406.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCNC(=O)CN(CCCCCC(=O)NO)C(=O)c1ccc(N(C)C)cc1
Standard InChI: InChI=1S/C21H34N4O4/c1-4-5-14-22-20(27)16-25(15-8-6-7-9-19(26)23-29)21(28)17-10-12-18(13-11-17)24(2)3/h10-13,29H,4-9,14-16H2,1-3H3,(H,22,27)(H,23,26)
Standard InChI Key: DYRUOELLDRMZCM-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
11.7116 -10.2355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1088 -10.9497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1316 -9.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8946 -10.2224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4974 -9.5082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4746 -10.9234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6566 -10.9056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2367 -11.6058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6339 -12.3209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4553 -12.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8714 -11.6307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9486 -9.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3686 -8.8465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3458 -10.2618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1856 -8.8597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9259 -10.9628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3231 -11.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1401 -11.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5373 -12.4043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3544 -12.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7516 -13.1316 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7743 -11.7164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3317 -13.8327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2150 -13.0225 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3979 -13.0105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6131 -13.7362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5828 -9.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3999 -9.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7971 -10.3012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 0
4 5 2 0
4 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
3 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
2 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
9 24 1 0
24 25 1 0
24 26 1 0
15 27 1 0
27 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 406.53Molecular Weight (Monoisotopic): 406.2580AlogP: 2.18#Rotatable Bonds: 13Polar Surface Area: 101.98Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.91CX Basic pKa: 3.46CX LogP: 1.68CX LogD: 1.67Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.26Np Likeness Score: -1.15
References 1. Krieger V, Hamacher A, Gertzen CGW, Senger J, Zwinderman MRH, Marek M, Romier C, Dekker FJ, Kurz T, Jung M, Gohlke H, Kassack MU, Hansen FK.. (2017) Design, Multicomponent Synthesis, and Anticancer Activity of a Focused Histone Deacetylase (HDAC) Inhibitor Library with Peptoid-Based Cap Groups., 60 (13): [PMID:28574690 ] [10.1021/acs.jmedchem.7b00197 ]