8,8'-Disulfanediylbis(N-(benzo[d][1,3]dioxol-5-ylmethyl)-quinoline-3-carboxamide)

ID: ALA4060337

PubChem CID: 126599609

Max Phase: Preclinical

Molecular Formula: C36H26N4O6S2

Molecular Weight: 674.76

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCc1ccc2c(c1)OCO2)c1cnc2c(SSc3cccc4cc(C(=O)NCc5ccc6c(c5)OCO6)cnc34)cccc2c1

Standard InChI:  InChI=1S/C36H26N4O6S2/c41-35(39-15-21-7-9-27-29(11-21)45-19-43-27)25-13-23-3-1-5-31(33(23)37-17-25)47-48-32-6-2-4-24-14-26(18-38-34(24)32)36(42)40-16-22-8-10-28-30(12-22)46-20-44-28/h1-14,17-18H,15-16,19-20H2,(H,39,41)(H,40,42)

Standard InChI Key:  JCTJRDCMJZWTNM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 48 55  0  0  0  0  0  0  0  0999 V2000
   24.8610  -16.2943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8599  -17.1138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5679  -17.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5661  -15.8854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2747  -16.2907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2755  -17.1097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9840  -17.5167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.6923  -17.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6876  -16.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9785  -15.8804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5698  -18.3400    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   24.8630  -18.7502    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   24.8649  -19.5674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8655  -21.1977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5746  -20.7831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5696  -19.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1563  -20.7899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1554  -19.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4522  -19.5733    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.7494  -19.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7542  -20.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4580  -21.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3928  -15.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1030  -16.2752    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3878  -15.0537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.0491  -21.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3388  -20.8058    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0542  -22.0272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8082  -15.8623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6337  -21.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9234  -20.8146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5183  -16.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9224  -19.9974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2130  -19.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2246  -21.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5189  -17.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2283  -17.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2170  -15.8530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9269  -16.2535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9351  -17.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7165  -17.3179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1914  -16.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7033  -15.9927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5146  -20.8278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5050  -20.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7213  -19.7623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2465  -20.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7368  -21.0905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  3 11  1  0
 11 12  1  0
 12 13  1  0
 13 18  2  0
 17 14  2  0
 14 15  1  0
 15 16  2  0
 16 13  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  9 23  1  0
 23 24  1  0
 23 25  2  0
 21 26  1  0
 26 27  1  0
 26 28  2  0
 24 29  1  0
 27 30  1  0
 30 31  1  0
 29 32  1  0
 31 33  2  0
 33 34  1  0
 34 45  2  0
 44 35  2  0
 35 31  1  0
 32 36  2  0
 36 37  1  0
 37 40  2  0
 39 38  2  0
 38 32  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 43 39  1  0
 44 45  1  0
 45 46  1  0
 46 47  1  0
 47 48  1  0
 48 44  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4060337

    ---

Associated Targets(Human)

PSMD14 Tchem 26S proteasome non-ATPase regulatory subunit 14 (475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
COPS5 Tchem COP9 signalosome complex subunit 5 (35 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
STAMBP Tchem STAM-binding protein (28 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 674.76Molecular Weight (Monoisotopic): 674.1294AlogP: 6.90#Rotatable Bonds: 9
Polar Surface Area: 120.90Molecular Species: NEUTRALHBA: 10HBD: 2
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.78CX Basic pKa: 2.17CX LogP: 5.73CX LogD: 5.73
Aromatic Rings: 6Heavy Atoms: 48QED Weighted: 0.16Np Likeness Score: -0.55

References

1. Perez C, Li J, Parlati F, Rouffet M, Ma Y, Mackinnon AL, Chou TF, Deshaies RJ, Cohen SM..  (2017)  Discovery of an Inhibitor of the Proteasome Subunit Rpn11.,  60  (4): [PMID:28191850] [10.1021/acs.jmedchem.6b01379]
2. Perez, Christian C and 8 more authors.  2017-02-23  Discovery of an Inhibitor of the Proteasome Subunit Rpn11.  [PMID:28191850]

Source