The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[4-(Morpholin-4-yl)piperidin-1-yl]benzyl-N-carbamimidoylcarbamate trihydrochloride ID: ALA4060583
PubChem CID: 146029983
Max Phase: Preclinical
Molecular Formula: C18H30Cl3N5O3
Molecular Weight: 361.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cl.Cl.Cl.N=C(N)NC(=O)OCc1cccc(N2CCC(N3CCOCC3)CC2)c1
Standard InChI: InChI=1S/C18H27N5O3.3ClH/c19-17(20)21-18(24)26-13-14-2-1-3-16(12-14)22-6-4-15(5-7-22)23-8-10-25-11-9-23;;;/h1-3,12,15H,4-11,13H2,(H4,19,20,21,24);3*1H
Standard InChI Key: WNISZOQHYUHFJD-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 28 0 0 0 0 0 0 0 0999 V2000
11.0951 -12.2818 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.7996 -10.0751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5177 -10.4906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9460 -10.4918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2322 -10.0764 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9453 -11.3128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3727 -9.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6606 -10.0776 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9414 -9.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5170 -11.3116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6571 -10.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3727 -10.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6571 -8.8392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2300 -10.4899 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9414 -10.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0840 -10.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5177 -10.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8084 -10.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8077 -11.3129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5224 -11.7238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2379 -11.3109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0989 -11.7224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3862 -11.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6760 -11.7173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6721 -12.5404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3847 -12.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1012 -12.5438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1075 -12.2818 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.0568 -12.2818 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
4 6 2 0
11 15 2 0
15 9 1 0
4 8 1 0
13 7 1 0
12 7 2 0
12 11 1 0
9 13 2 0
16 12 1 0
3 5 1 0
5 4 1 0
3 10 2 0
2 16 1 0
15 14 1 0
14 17 1 0
14 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
19 22 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 361.45Molecular Weight (Monoisotopic): 361.2114AlogP: 1.11#Rotatable Bonds: 4Polar Surface Area: 103.91Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.31CX Basic pKa: 8.16CX LogP: 0.95CX LogD: -0.20Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.55Np Likeness Score: -1.13
References 1. Yamaki S, Yamada H, Nagashima A, Kondo M, Shimada Y, Kadono K, Yoshihara K.. (2017) Synthesis and structure activity relationships of carbamimidoylcarbamate derivatives as novel vascular adhesion protein-1 inhibitors., 25 (21): [PMID:28988626 ] [10.1016/j.bmc.2017.09.036 ]