Euphoboetirane N

ID: ALA4060707

PubChem CID: 132502908

Max Phase: Preclinical

Molecular Formula: C28H33F3O5

Molecular Weight: 506.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1CC[C@H]2[C@@H](/C=C(\C)C(=O)[C@@]3(O)C[C@H](C)[C@H](O)[C@@H]3[C@H]1OC(=O)c1cccc(C(F)(F)F)c1)C2(C)C

Standard InChI:  InChI=1S/C28H33F3O5/c1-14-9-10-19-20(26(19,4)5)11-15(2)24(33)27(35)13-16(3)22(32)21(27)23(14)36-25(34)17-7-6-8-18(12-17)28(29,30)31/h6-8,11-12,16,19-23,32,35H,1,9-10,13H2,2-5H3/b15-11+/t16-,19-,20+,21+,22-,23-,27+/m0/s1

Standard InChI Key:  FVPSODHFKMFEPJ-ORUQBICOSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   26.5628  -11.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1300   -9.0221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7255   -9.7320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5425   -9.7273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7465   -9.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7466  -11.4744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5661   -9.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1635  -10.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1673  -10.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3852   -9.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8980  -10.4855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3792  -11.1539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1412  -10.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1449  -10.8984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9249  -11.1480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9189   -9.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4009  -10.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8802   -8.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4337   -8.7454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2167  -10.4790    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.9124   -9.0056    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.0809  -10.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1231  -11.9300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.9450  -11.6883    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.4380  -12.2310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7510   -9.3688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9390  -12.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6304  -13.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7486  -12.7655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8737  -12.2295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8204  -13.7413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5118  -14.4972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0130  -15.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8265  -15.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1313  -14.2735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7022  -14.6079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3932  -15.3645    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.2014  -13.9621    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.8814  -14.6021    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  4  3  1  0
  9  5  1  0
  8  6  1  0
  6  1  1  0
  1 14  1  0
 13  7  2  0
  7  5  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
 14 15  1  0
 15 17  1  0
 16 13  1  0
 17 16  1  0
  3 17  1  0
 16  3  1  0
  7 18  1  0
  5 19  2  0
 17 20  1  6
 16 21  1  6
 11 22  1  1
 12 23  1  1
  8 24  1  6
  6 25  1  6
  9 26  1  1
 25 27  1  0
 27 28  1  0
 27 29  2  0
  1 30  2  0
 28 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 28  1  0
 32 36  1  0
 36 37  1  0
 36 38  1  0
 36 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4060707

    ---

Associated Targets(non-human)

Saccharomyces cerevisiae (19171 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.56Molecular Weight (Monoisotopic): 506.2280AlogP: 5.12#Rotatable Bonds: 2
Polar Surface Area: 83.83Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.64CX Basic pKa: CX LogP: 5.71CX LogD: 5.71
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.43Np Likeness Score: 2.00

References

1. Mónico A, Nim S, Duarte N, Rawal MK, Prasad R, Di Pietro A, Ferreira MU..  (2017)  Lathyrol and epoxylathyrol derivatives: Modulation of Cdr1p and Mdr1p drug-efflux transporters of Candida albicans in Saccharomyces cerevisiae model.,  25  (13): [PMID:28479022] [10.1016/j.bmc.2017.04.016]

Source