The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(2-(1-([1,1'-Biphenyl]-4-yl)-5-methoxy-2-methyl-1H-indol-3-yl)acetamido)-N-((4-chloro-3-nitrophenyl)sulfonyl)-3-phenylpropanamide ID: ALA4060912
PubChem CID: 137635896
Max Phase: Preclinical
Molecular Formula: C39H33ClN4O7S
Molecular Weight: 737.23
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)c(CC(=O)N[C@@H](Cc1ccccc1)C(=O)NS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1)c(C)n2-c1ccc(-c2ccccc2)cc1
Standard InChI: InChI=1S/C39H33ClN4O7S/c1-25-32(33-22-30(51-2)17-20-36(33)43(25)29-15-13-28(14-16-29)27-11-7-4-8-12-27)24-38(45)41-35(21-26-9-5-3-6-10-26)39(46)42-52(49,50)31-18-19-34(40)37(23-31)44(47)48/h3-20,22-23,35H,21,24H2,1-2H3,(H,41,45)(H,42,46)/t35-/m0/s1
Standard InChI Key: BGVWDINPRHXDRI-DHUJRADRSA-N
Molfile:
RDKit 2D
52 57 0 0 0 0 0 0 0 0999 V2000
11.5621 -4.0943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2785 -4.5066 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.2774 -3.6800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2632 -5.5024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0409 -6.2969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6132 -6.8878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6869 -4.9117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0618 -5.2988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1070 -4.5309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5361 -3.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3610 -3.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7566 -4.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3275 -5.2720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5027 -5.2540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3909 -7.6822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9672 -8.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7450 -9.0676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9422 -9.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3699 -8.6805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5922 -7.8860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6659 -5.9099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8570 -6.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9298 -5.1307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2381 -6.5007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5753 -8.1843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0644 -7.5245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5888 -6.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8038 -7.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0964 -6.6738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3728 -7.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3651 -7.9050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0726 -8.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7919 -7.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8890 -7.5364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6654 -6.6584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9460 -7.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3087 -10.5477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8651 -9.9424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6234 -9.1574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8170 -8.9735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2564 -9.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5022 -10.3681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5546 -11.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9940 -11.9424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2357 -12.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0421 -12.9113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6027 -12.3059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3568 -11.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7902 -3.1343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3939 -2.4112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6147 -3.1528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5811 -4.5860 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
4 7 2 0
4 8 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
2 9 1 0
8 2 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
6 15 1 0
21 22 1 0
21 23 2 0
21 24 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
25 33 1 0
28 33 2 0
26 34 1 0
35 36 1 0
30 35 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
37 42 2 0
43 44 1 0
44 45 2 0
45 46 1 0
46 47 2 0
47 48 1 0
43 48 2 0
37 43 1 0
25 40 1 0
22 27 1 0
5 24 1 6
49 50 2 0
49 51 1 0
11 49 1 0
12 52 1 0
M CHG 2 49 1 51 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 737.23Molecular Weight (Monoisotopic): 736.1758AlogP: 6.95#Rotatable Bonds: 12Polar Surface Area: 149.64Molecular Species: ACIDHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.01CX Basic pKa: ┄CX LogP: 7.74CX LogD: 6.79Aromatic Rings: 6Heavy Atoms: 52QED Weighted: 0.10Np Likeness Score: -1.11
References 1. Xu G, Liu T, Zhou Y, Yang X, Fang H.. (2017) 1-Phenyl-1H-indole derivatives as a new class of Bcl-2/Mcl-1 dual inhibitors: Design, synthesis, and preliminary biological evaluation., 25 (20): [PMID:28866374 ] [10.1016/j.bmc.2017.08.024 ]