(S)-3-((1r,4S)-4-(4-amino-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)cyclohexylamino)pyrrolidin-2-one

ID: ALA4061078

PubChem CID: 73051657

Max Phase: Preclinical

Molecular Formula: C28H30N6O2

Molecular Weight: 482.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)cn2[C@H]1CC[C@H](N[C@H]2CCNC2=O)CC1

Standard InChI:  InChI=1S/C28H30N6O2/c29-26-25-23(18-6-12-22(13-7-18)36-21-4-2-1-3-5-21)16-34(27(25)32-17-31-26)20-10-8-19(9-11-20)33-24-14-15-30-28(24)35/h1-7,12-13,16-17,19-20,24,33H,8-11,14-15H2,(H,30,35)(H2,29,31,32)/t19-,20-,24-/m0/s1

Standard InChI Key:  DBOIRLRAXAVLDQ-SKPFHBQLSA-N

Molfile:  

     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   36.4131   -6.8264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.4120   -7.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1200   -8.0549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.1182   -6.4175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8269   -6.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8317   -7.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6161   -7.8958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.0961   -7.2269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6082   -6.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8562   -5.7852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6538   -5.6161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9018   -4.8383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3512   -4.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5493   -4.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3050   -5.1890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8709   -8.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3255   -9.2791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5796  -10.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3794  -10.2215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9248   -9.6116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6703   -8.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6327  -10.9927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.5981   -3.4543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.3962   -3.2786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9458   -3.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7432   -3.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9908   -2.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4348   -2.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6395   -2.5014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1158   -5.6003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.4326  -11.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7705  -11.9013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5829  -11.8132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7503  -11.0133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.0412  -10.6071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9526   -9.7947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.0176  -11.8617    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 16  7  1  1
 19 22  1  6
 13 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  4 30  1  0
 22 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 31  1  0
 35 36  2  0
 31 37  1  1
M  END

Associated Targets(Human)

HCK Tclin Tyrosine-protein kinase HCK (2743 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.59Molecular Weight (Monoisotopic): 482.2430AlogP: 4.43#Rotatable Bonds: 6
Polar Surface Area: 107.09Molecular Species: BASEHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.31CX LogP: 3.39CX LogD: 1.47
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.38Np Likeness Score: -0.43

References

1. Yuki H, Kikuzato K, Koda Y, Mikuni J, Tomabechi Y, Kukimoto-Niino M, Tanaka A, Shirai F, Shirouzu M, Koyama H, Honma T..  (2017)  Activity cliff for 7-substituted pyrrolo-pyrimidine inhibitors of HCK explained in terms of predicted basicity of the amine nitrogen.,  25  (16): [PMID:28662963] [10.1016/j.bmc.2017.05.053]

Source