The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-((1r,4S)-4-(4-amino-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)cyclohexylamino)pyrrolidin-2-one ID: ALA4061078
PubChem CID: 73051657
Max Phase: Preclinical
Molecular Formula: C28H30N6O2
Molecular Weight: 482.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)cn2[C@H]1CC[C@H](N[C@H]2CCNC2=O)CC1
Standard InChI: InChI=1S/C28H30N6O2/c29-26-25-23(18-6-12-22(13-7-18)36-21-4-2-1-3-5-21)16-34(27(25)32-17-31-26)20-10-8-19(9-11-20)33-24-14-15-30-28(24)35/h1-7,12-13,16-17,19-20,24,33H,8-11,14-15H2,(H,30,35)(H2,29,31,32)/t19-,20-,24-/m0/s1
Standard InChI Key: DBOIRLRAXAVLDQ-SKPFHBQLSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
36.4131 -6.8264 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4120 -7.6459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1200 -8.0549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1182 -6.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8269 -6.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8317 -7.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6161 -7.8958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.0961 -7.2269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6082 -6.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8562 -5.7852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6538 -5.6161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9018 -4.8383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3512 -4.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5493 -4.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3050 -5.1890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8709 -8.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3255 -9.2791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5796 -10.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3794 -10.2215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9248 -9.6116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6703 -8.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6327 -10.9927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.5981 -3.4543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.3962 -3.2786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9458 -3.8827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7432 -3.7075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9908 -2.9278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4348 -2.3231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6395 -2.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1158 -5.6003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.4326 -11.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7705 -11.9013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5829 -11.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7503 -11.0133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.0412 -10.6071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9526 -9.7947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.0176 -11.8617 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
16 7 1 1
19 22 1 6
13 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
4 30 1 0
22 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 31 1 0
35 36 2 0
31 37 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.59Molecular Weight (Monoisotopic): 482.2430AlogP: 4.43#Rotatable Bonds: 6Polar Surface Area: 107.09Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.31CX LogP: 3.39CX LogD: 1.47Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.38Np Likeness Score: -0.43
References 1. Yuki H, Kikuzato K, Koda Y, Mikuni J, Tomabechi Y, Kukimoto-Niino M, Tanaka A, Shirai F, Shirouzu M, Koyama H, Honma T.. (2017) Activity cliff for 7-substituted pyrrolo-pyrimidine inhibitors of HCK explained in terms of predicted basicity of the amine nitrogen., 25 (16): [PMID:28662963 ] [10.1016/j.bmc.2017.05.053 ]