3-(4-Carboxymethoxy-3,2''-diisobutyl-2'-naphthalen-1-ylmethyl-[1,1':4',1'']terphenyl-4''-yl)-propionic acd

ID: ALA4061247

PubChem CID: 10232933

Max Phase: Preclinical

Molecular Formula: C42H44O5

Molecular Weight: 628.81

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)Cc1cc(-c2ccc(-c3ccc(CCC(=O)O)cc3CC(C)C)cc2Cc2cccc3ccccc23)ccc1OCC(=O)O

Standard InChI:  InChI=1S/C42H44O5/c1-27(2)20-34-22-29(13-19-41(43)44)12-16-38(34)32-14-17-39(33-15-18-40(47-26-42(45)46)36(25-33)21-28(3)4)35(24-32)23-31-10-7-9-30-8-5-6-11-37(30)31/h5-12,14-18,22,24-25,27-28H,13,19-21,23,26H2,1-4H3,(H,43,44)(H,45,46)

Standard InChI Key:  IOPUZOIMJHRZMR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 47 51  0  0  0  0  0  0  0  0999 V2000
   11.1570   -9.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1553   -5.6294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4426   -8.5170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7381  -14.7057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2997   -6.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5836   -5.6234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2999   -8.5116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0126   -5.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2984   -9.3351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8772  -11.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8732  -10.9850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8739   -9.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1671  -14.7022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5861  -10.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0131   -9.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4513  -14.2898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7275   -9.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4434   -6.0422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4448  -10.9887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1629  -13.0506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8736   -6.8692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4454  -11.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5844   -8.1009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8708   -6.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1571   -7.2825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3027   -6.8583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1608  -12.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3021  -10.9795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4423   -6.8696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4372   -4.3941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0150  -10.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1477   -3.1526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3053  -11.8045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8710   -8.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4420   -9.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1605  -10.5761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1588   -8.1053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1529   -4.8044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7188   -3.1569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4494  -13.4648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4347   -3.5691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0075   -8.0952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7195   -8.5043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4276   -8.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4250   -7.2714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7083   -6.8643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0031   -7.2786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 40 16  1  0
  1 36  1  0
 37  3  2  0
 36 19  2  0
  2 18  1  0
 34 23  1  0
 42  7  1  0
 25 37  1  0
 11 14  1  0
 41 39  2  0
  5 26  1  0
 17 43  1  0
 23  7  1  0
  6  5  1  0
 22 27  2  0
 41 32  1  0
 29 25  1  0
 14 28  1  0
 15 17  2  0
 24  2  2  0
 28 33  1  0
 12 34  2  0
 27 10  1  0
 10 11  2  0
 16 13  2  0
  1 12  1  0
 24  6  1  0
 35  1  2  0
 19 22  1  0
  9 15  1  0
 20 40  1  0
  2 38  1  0
 38 30  1  0
 34 37  1  0
 21 24  1  0
 16  4  1  0
  5  8  1  0
 27 20  1  0
 28 31  1  0
 11 36  1  0
  3 35  1  0
 18 29  2  0
 30 41  1  0
 25 21  2  0
  7  9  2  0
 42 43  1  0
 43 44  2  0
 44 45  1  0
 45 46  2  0
 46 47  1  0
 47 42  2  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

BCL2L1 Tchem Apoptosis regulator Bcl-X (2604 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 628.81Molecular Weight (Monoisotopic): 628.3189AlogP: 9.64#Rotatable Bonds: 14
Polar Surface Area: 83.83Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.95CX Basic pKa: CX LogP: 11.13CX LogD: 5.49
Aromatic Rings: 5Heavy Atoms: 47QED Weighted: 0.13Np Likeness Score: 0.12

References

1. Yap JL, Chen L, Lanning ME, Fletcher S..  (2017)  Expanding the Cancer Arsenal with Targeted Therapies: Disarmament of the Antiapoptotic Bcl-2 Proteins by Small Molecules.,  60  (3): [PMID:27749061] [10.1021/acs.jmedchem.5b01888]

Source