6,5-dichloroindirubin-3'-oxime

ID: ALA4061357

PubChem CID: 135499828

Max Phase: Preclinical

Molecular Formula: C16H9Cl2N3O2

Molecular Weight: 346.17

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1Nc2cc(Cl)c(Cl)cc2/C1=C1/Nc2ccccc2/C1=N\O

Standard InChI:  InChI=1S/C16H9Cl2N3O2/c17-9-5-8-12(6-10(9)18)20-16(22)13(8)15-14(21-23)7-3-1-2-4-11(7)19-15/h1-6,19,23H,(H,20,22)/b15-13-,21-14+

Standard InChI Key:  XFTCKLNUSFOJAU-WQGZHNTLSA-N

Molfile:  

     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
   28.8311  -22.7618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8300  -23.5891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5447  -24.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5429  -22.3490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2582  -22.7582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2632  -23.5892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0550  -23.8414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5395  -23.1662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0471  -22.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2974  -21.7108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7418  -21.1009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3645  -23.1613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8546  -23.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6377  -23.5612    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6063  -24.6075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.8468  -22.4861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6308  -22.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2395  -22.1867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0656  -21.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2773  -21.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6719  -21.6857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0998  -20.3263    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   34.6756  -20.8265    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  2  0
 10 11  1  0
  8 12  2  0
 12 13  1  0
 13 14  1  0
 14 17  1  0
 16 12  1  0
 13 15  2  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 20 22  1  0
 19 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4061357

    ---

Associated Targets(Human)

GSK3A Tclin Glycogen synthase kinase-3 (736 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 346.17Molecular Weight (Monoisotopic): 345.0072AlogP: 3.96#Rotatable Bonds:
Polar Surface Area: 73.72Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 6.57CX Basic pKa: 0.58CX LogP: 3.00CX LogD: 2.12
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.38Np Likeness Score: -0.09

References

1. Khan I, Tantray MA, Alam MS, Hamid H..  (2017)  Natural and synthetic bioactive inhibitors of glycogen synthase kinase.,  125  [PMID:27689729] [10.1016/j.ejmech.2016.09.058]

Source