The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(2-aminophenyl)-3-(1-((3S,5S)-5-(hydroxymethyl)-1-(3-phenylpropyl)pyrrolidin-3-yl)-1H-1,2,3-triazol-4-yl)acrylamide ID: ALA4061632
PubChem CID: 137636394
Max Phase: Preclinical
Molecular Formula: C25H30N6O2
Molecular Weight: 446.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ccccc1NC(=O)/C=C/c1cn([C@H]2C[C@@H](CO)N(CCCc3ccccc3)C2)nn1
Standard InChI: InChI=1S/C25H30N6O2/c26-23-10-4-5-11-24(23)27-25(33)13-12-20-16-31(29-28-20)21-15-22(18-32)30(17-21)14-6-9-19-7-2-1-3-8-19/h1-5,7-8,10-13,16,21-22,32H,6,9,14-15,17-18,26H2,(H,27,33)/b13-12+/t21-,22-/m0/s1
Standard InChI Key: KABCWLRJCDKRTD-WYCPQIHASA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
16.6724 -18.6854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6707 -19.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3803 -19.9194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0964 -19.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0921 -18.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3817 -18.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3800 -20.7366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8065 -19.9164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5146 -19.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2247 -19.9131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5127 -18.6848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9369 -19.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6470 -19.9138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7265 -20.7260 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5294 -20.8949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9405 -20.1847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3911 -19.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7505 -20.0957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3040 -20.7049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0505 -20.3686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9644 -19.5542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1615 -19.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5695 -19.0048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3515 -19.2574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9607 -18.7080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7427 -18.9565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9098 -19.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6864 -20.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2970 -19.4594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1230 -18.6560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3426 -18.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7606 -20.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7627 -21.5968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
4 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 13 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
18 16 1 6
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
20 32 1 6
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.56Molecular Weight (Monoisotopic): 446.2430AlogP: 2.75#Rotatable Bonds: 9Polar Surface Area: 109.30Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.10CX LogP: 2.82CX LogD: 1.11Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -0.92
References 1. Tian Y, Lv W, Li X, Wang C, Wang D, Wang PG, Jin J, Shen J.. (2017) Stabilizing HDAC11 with SAHA to assay slow-binding benzamide inhibitors., 27 (13): [PMID:28501514 ] [10.1016/j.bmcl.2017.05.004 ]