The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((1,1-Dioxidothiomorpholino)methyl)benzamido)-6-(hydroxymethyl)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxamide ID: ALA4062022
PubChem CID: 137637550
Max Phase: Preclinical
Molecular Formula: C22H27N3O5S2
Molecular Weight: 477.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1c(NC(=O)c2ccc(CN3CCS(=O)(=O)CC3)cc2)sc2c1CCC(CO)C2
Standard InChI: InChI=1S/C22H27N3O5S2/c23-20(27)19-17-6-3-15(13-26)11-18(17)31-22(19)24-21(28)16-4-1-14(2-5-16)12-25-7-9-32(29,30)10-8-25/h1-2,4-5,15,26H,3,6-13H2,(H2,23,27)(H,24,28)
Standard InChI Key: GBEPILPAVQVXJT-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
37.5248 -14.9364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.7365 -14.7260 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.9483 -15.5139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1783 -14.5733 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.4326 -13.7966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7697 -13.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7684 -12.4972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4755 -12.0876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0601 -12.0897 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.2102 -13.5451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8167 -14.0928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5943 -13.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6457 -14.8919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.1967 -14.3910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9736 -14.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1452 -13.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5338 -12.7918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7592 -13.0456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3611 -14.5733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1094 -13.8009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3191 -13.6336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7748 -14.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0264 -15.0081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8224 -15.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9225 -13.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5297 -13.6347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3555 -14.4313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9588 -14.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9097 -13.9288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3029 -13.3775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4795 -15.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6802 -15.4452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
19 4 1 0
4 5 1 0
5 6 2 0
6 20 1 0
6 7 1 0
7 8 1 0
7 9 2 0
5 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 12 1 0
19 20 2 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
16 25 1 0
25 26 1 0
26 27 1 0
26 30 1 0
27 28 1 0
28 2 1 0
2 29 1 0
29 30 1 0
23 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.61Molecular Weight (Monoisotopic): 477.1392AlogP: 1.43#Rotatable Bonds: 6Polar Surface Area: 129.80Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.87CX LogP: 1.63CX LogD: 1.63Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.58Np Likeness Score: -1.67
References 1. Llona-Minguez S, Fayezi S, Alihemmati A, Juárez-Jiménez J, Piedrafita FJ, Helleday T.. (2017) Tetrahydrobenzothiophene carboxamides: Beyond the kinase domain and into the fatty acid realm., 27 (18): [PMID:28807439 ] [10.1016/j.bmcl.2017.08.006 ]