The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8,8'-Disulfanediylbis(N-(pyridin-2-ylmethyl)quinoline-3-carboxamide) ID: ALA4062208
PubChem CID: 126599616
Max Phase: Preclinical
Molecular Formula: C32H24N6O2S2
Molecular Weight: 588.72
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1ccccn1)c1cnc2c(SSc3cccc4cc(C(=O)NCc5ccccn5)cnc34)cccc2c1
Standard InChI: InChI=1S/C32H24N6O2S2/c39-31(37-19-25-9-1-3-13-33-25)23-15-21-7-5-11-27(29(21)35-17-23)41-42-28-12-6-8-22-16-24(18-36-30(22)28)32(40)38-20-26-10-2-4-14-34-26/h1-18H,19-20H2,(H,37,39)(H,38,40)
Standard InChI Key: ZGBWITBAJFSYHV-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
24.8610 -16.2943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8599 -17.1138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5679 -17.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5661 -15.8854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2747 -16.2907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2755 -17.1097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9840 -17.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6923 -17.1059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6876 -16.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9785 -15.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5698 -18.3400 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.8630 -18.7502 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.8649 -19.5674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8655 -21.1977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5746 -20.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5696 -19.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1563 -20.7899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1554 -19.9771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4522 -19.5733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7494 -19.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7542 -20.7970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4580 -21.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3928 -15.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1030 -16.2752 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3878 -15.0537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0491 -21.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3388 -20.8058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0542 -22.0272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8082 -15.8623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6337 -21.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9234 -20.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5183 -16.2666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9224 -19.9974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2130 -19.5933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5069 -20.0064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5146 -20.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2246 -21.2282 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5189 -17.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2283 -17.4879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9345 -17.0749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9269 -16.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2170 -15.8530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 11 1 0
11 12 1 0
12 13 1 0
13 18 2 0
17 14 2 0
14 15 1 0
15 16 2 0
16 13 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
9 23 1 0
23 24 1 0
23 25 2 0
21 26 1 0
26 27 1 0
26 28 2 0
24 29 1 0
27 30 1 0
30 31 1 0
29 32 1 0
31 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 31 1 0
32 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 588.72Molecular Weight (Monoisotopic): 588.1402AlogP: 6.23#Rotatable Bonds: 9Polar Surface Area: 109.76Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.65CX Basic pKa: 4.45CX LogP: 4.21CX LogD: 4.21Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.19Np Likeness Score: -0.94
References 1. Perez C, Li J, Parlati F, Rouffet M, Ma Y, Mackinnon AL, Chou TF, Deshaies RJ, Cohen SM.. (2017) Discovery of an Inhibitor of the Proteasome Subunit Rpn11., 60 (4): [PMID:28191850 ] [10.1021/acs.jmedchem.6b01379 ] 2. Perez, Christian C and 8 more authors. 2017-02-23 Discovery of an Inhibitor of the Proteasome Subunit Rpn11. [PMID:28191850 ]