4-Amino-N-(3-(6-(3-pyrrolidin-1-yl)propoxy)benzo[d]oxazol-2-yl)phenylbenzamide

ID: ALA4062511

PubChem CID: 137635490

Max Phase: Preclinical

Molecular Formula: C27H28N4O3

Molecular Weight: 456.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ccc(C(=O)Nc2cccc(-c3nc4ccc(OCCCN5CCCC5)cc4o3)c2)cc1

Standard InChI:  InChI=1S/C27H28N4O3/c28-21-9-7-19(8-10-21)26(32)29-22-6-3-5-20(17-22)27-30-24-12-11-23(18-25(24)34-27)33-16-4-15-31-13-1-2-14-31/h3,5-12,17-18H,1-2,4,13-16,28H2,(H,29,32)

Standard InChI Key:  JBZIUIXKIUHCQZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   13.9207  -11.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3293  -10.4218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9207   -9.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3293   -9.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1506   -9.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5592   -9.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1506  -10.4218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3293  -11.8432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0994  -11.1325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6908  -10.4218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8695  -10.4218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4609   -9.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8695   -9.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6908   -9.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0994   -9.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1594  -10.3768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6396   -9.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1594   -9.0496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3781   -9.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3781  -10.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6690  -10.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9599  -10.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9599   -9.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6690   -8.8981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2508  -10.5366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5376  -10.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8285  -10.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1194  -10.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4103  -10.5366    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3222  -11.3482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5196  -11.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1110  -10.8052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6589  -10.2024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5592   -8.2939    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  1  8  2  0
  1  9  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 16 20  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 19 24  2  0
 20 21  2  0
 26 27  1  0
 27 28  1  0
 25 26  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 29 33  1  0
 28 29  1  0
 22 25  1  0
 12 17  1  0
  9 10  1  0
  5 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4062511

    ---

Associated Targets(Human)

TLR9 Tclin Toll-like receptor 9 (943 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.55Molecular Weight (Monoisotopic): 456.2161AlogP: 5.19#Rotatable Bonds: 8
Polar Surface Area: 93.62Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.27CX LogP: 3.93CX LogD: 2.07
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.28Np Likeness Score: -1.66

References

1. Roy S, Mukherjee A, Paul B, Rahaman O, Roy S, Maithri G, Ramya B, Pal S, Ganguly D, Talukdar A..  (2017)  Design and development of benzoxazole derivatives with toll-like receptor 9 antagonism.,  134  [PMID:28437629] [10.1016/j.ejmech.2017.03.086]

Source