The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Amino-N-(3-(6-(3-pyrrolidin-1-yl)propoxy)benzo[d]oxazol-2-yl)phenylbenzamide ID: ALA4062511
PubChem CID: 137635490
Max Phase: Preclinical
Molecular Formula: C27H28N4O3
Molecular Weight: 456.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ccc(C(=O)Nc2cccc(-c3nc4ccc(OCCCN5CCCC5)cc4o3)c2)cc1
Standard InChI: InChI=1S/C27H28N4O3/c28-21-9-7-19(8-10-21)26(32)29-22-6-3-5-20(17-22)27-30-24-12-11-23(18-25(24)34-27)33-16-4-15-31-13-1-2-14-31/h3,5-12,17-18H,1-2,4,13-16,28H2,(H,29,32)
Standard InChI Key: JBZIUIXKIUHCQZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
13.9207 -11.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3293 -10.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9207 -9.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3293 -9.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1506 -9.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5592 -9.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1506 -10.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3293 -11.8432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0994 -11.1325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6908 -10.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8695 -10.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4609 -9.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8695 -9.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6908 -9.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0994 -9.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1594 -10.3768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6396 -9.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1594 -9.0496 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3781 -9.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3781 -10.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6690 -10.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9599 -10.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9599 -9.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6690 -8.8981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2508 -10.5366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5376 -10.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8285 -10.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1194 -10.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4103 -10.5366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3222 -11.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5196 -11.5159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1110 -10.8052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6589 -10.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5592 -8.2939 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
1 8 2 0
1 9 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
16 20 1 0
21 22 1 0
22 23 2 0
23 24 1 0
19 24 2 0
20 21 2 0
26 27 1 0
27 28 1 0
25 26 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
29 33 1 0
28 29 1 0
22 25 1 0
12 17 1 0
9 10 1 0
5 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.55Molecular Weight (Monoisotopic): 456.2161AlogP: 5.19#Rotatable Bonds: 8Polar Surface Area: 93.62Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.27CX LogP: 3.93CX LogD: 2.07Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.28Np Likeness Score: -1.66
References 1. Roy S, Mukherjee A, Paul B, Rahaman O, Roy S, Maithri G, Ramya B, Pal S, Ganguly D, Talukdar A.. (2017) Design and development of benzoxazole derivatives with toll-like receptor 9 antagonism., 134 [PMID:28437629 ] [10.1016/j.ejmech.2017.03.086 ]