{2-[({6-[4-(trifluoromethyl)phenoxy]pyridin-3-yl}carbonyl)amino]phenyl}boronic acid

ID: ALA4062688

PubChem CID: 137635980

Max Phase: Preclinical

Molecular Formula: C19H14BF3N2O4

Molecular Weight: 402.14

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccccc1B(O)O)c1ccc(Oc2ccc(C(F)(F)F)cc2)nc1

Standard InChI:  InChI=1S/C19H14BF3N2O4/c21-19(22,23)13-6-8-14(9-7-13)29-17-10-5-12(11-24-17)18(26)25-16-4-2-1-3-15(16)20(27)28/h1-11,27-28H,(H,25,26)

Standard InChI Key:  BSEMWFJQFPJFHX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   16.7668  -10.9467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0533  -10.5307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0610   -9.7151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3547   -9.2992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6447   -9.7061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6413  -10.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3456  -10.9341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6162   -9.3260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9060   -9.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9004  -10.5472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1887  -10.9561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4785  -10.5397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4877   -9.7267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1994   -9.3179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6177   -8.5079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3187   -9.7373    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0324   -9.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7385   -9.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4522   -9.3360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4579   -8.5180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7498   -8.1052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0360   -8.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7314  -10.5578    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   13.9386   -9.2949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9416   -8.4777    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.2293   -9.7009    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.2278   -8.8859    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.0202  -10.9602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.4355  -10.9725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  1  2  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  9 14  2  0
  8 15  2  0
  8 16  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 17 22  2  0
 18 23  1  0
 16 17  1  0
 12  1  1  0
  5 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
 23 28  1  0
 23 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4062688

    ---

Associated Targets(Human)

LIPE Tchem Hormone sensitive lipase (506 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.14Molecular Weight (Monoisotopic): 402.0999AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Ogiyama T, Yamaguchi M, Kurikawa N, Honzumi S, Yamamoto Y, Sugiyama D, Takakusa H, Inoue SI..  (2017)  Identification of a novel hormone sensitive lipase inhibitor with a reduced potential of reactive metabolites formation.,  25  (7): [PMID:28279560] [10.1016/j.bmc.2017.02.045]

Source