2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl 3-nitrobenzoate

ID: ALA4062846

PubChem CID: 137635719

Max Phase: Preclinical

Molecular Formula: C13H12N4O6

Molecular Weight: 320.26

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1cccc([N+](=O)[O-])c1

Standard InChI:  InChI=1S/C13H12N4O6/c1-9-14-8-12(17(21)22)15(9)5-6-23-13(18)10-3-2-4-11(7-10)16(19)20/h2-4,7-8H,5-6H2,1H3

Standard InChI Key:  MLRIAJYDGAUANZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
    3.8455  -10.6938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4999  -10.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2386   -9.4300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4189   -9.4409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1800  -10.2215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8556  -11.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2823  -10.4470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8827   -9.8926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4622  -11.2442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5683  -11.9107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5784  -12.7278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2911  -13.1276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3013  -13.9447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9937  -12.7103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4065  -10.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5979  -14.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6077  -15.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3210  -15.5741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0258  -15.1523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0126  -14.3373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7415  -15.5517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4426  -15.1319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7545  -16.3688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  2  7  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  5 15  1  0
 13 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 13  1  0
 21 22  2  0
 21 23  1  0
 19 21  1  0
M  CHG  4   7   1   9  -1  21   1  23  -1
M  END

Alternative Forms

  1. Parent:

    ALA4062846

    ---

Associated Targets(non-human)

GUSB Beta-glucuronidase (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 320.26Molecular Weight (Monoisotopic): 320.0757AlogP: 1.86#Rotatable Bonds: 6
Polar Surface Area: 130.40Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.27CX LogP: 1.98CX LogD: 1.98
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.45Np Likeness Score: -1.65

References

1. Salar U, Khan KM, Taha M, Ismail NH, Ali B, Qurat-Ul-Ain, Perveen S, Ghufran M, Wadood A..  (2017)  Biology-oriented drug synthesis (BIODS): In vitro β-glucuronidase inhibitory and in silico studies on 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl aryl carboxylate derivatives.,  125  [PMID:27886546] [10.1016/j.ejmech.2016.11.031]

Source