The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
benzyl (S)-1-((S)-1-(7-amino-2-oxo-2H-chromen-4-yl)-5-guanidino-1-oxopentan-2-ylamino)-4-methyl-1-oxopentan-2-ylcarbamate ID: ALA4062918
PubChem CID: 137635066
Max Phase: Preclinical
Molecular Formula: C29H36N6O6
Molecular Weight: 564.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)c1cc(=O)oc2cc(N)ccc12
Standard InChI: InChI=1S/C29H36N6O6/c1-17(2)13-23(35-29(39)40-16-18-7-4-3-5-8-18)27(38)34-22(9-6-12-33-28(31)32)26(37)21-15-25(36)41-24-14-19(30)10-11-20(21)24/h3-5,7-8,10-11,14-15,17,22-23H,6,9,12-13,16,30H2,1-2H3,(H,34,38)(H,35,39)(H4,31,32,33)/t22-,23-/m0/s1
Standard InChI Key: BDUPEQLYHUCJJY-GOTSBHOMSA-N
Molfile:
RDKit 2D
41 43 0 0 0 0 0 0 0 0999 V2000
8.1517 -11.7444 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1448 -10.9195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5649 -10.9195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8549 -10.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4348 -10.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4114 -9.2692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1269 -9.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1233 -10.5012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8333 -9.2702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8549 -9.6869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5686 -9.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8585 -8.0463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5686 -8.4538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2786 -9.6848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9887 -9.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6987 -9.6848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2786 -8.0463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4404 -12.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9838 -8.4574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6917 -8.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6960 -7.2337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3979 -8.4646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2720 -7.2297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9876 -6.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9936 -6.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2847 -5.5892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5683 -5.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5658 -6.8153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2892 -4.7678 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7320 -11.7552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4419 -12.9797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7350 -13.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7365 -14.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0288 -14.6109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0299 -15.4273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7389 -15.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4482 -15.4211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4436 -14.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2175 -9.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7922 -9.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4271 -9.5112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 10 1 0
13 17 1 0
1 2 1 0
2 4 1 0
4 3 2 0
2 5 1 1
6 7 1 0
7 8 1 0
7 9 2 0
10 11 1 0
11 13 1 0
13 12 2 0
11 14 1 6
14 15 1 0
15 16 1 0
16 6 1 0
1 18 1 0
17 19 2 0
17 23 1 0
19 20 1 0
20 21 1 0
21 24 1 0
20 22 2 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
18 30 2 0
18 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
5 39 1 0
39 40 1 0
39 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 564.64Molecular Weight (Monoisotopic): 564.2696AlogP: 2.65#Rotatable Bonds: 13Polar Surface Area: 202.63Molecular Species: BASEHBA: 8HBD: 6#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.42CX Basic pKa: 11.76CX LogP: 2.09CX LogD: -0.02Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.05Np Likeness Score: 0.07
References 1. Xie H, Chen G, Young RN.. (2017) Design, Synthesis, and Pharmacokinetics of a Bone-Targeting Dual-Action Prodrug for the Treatment of Osteoporosis., 60 (16): [PMID:28699744 ] [10.1021/acs.jmedchem.6b00951 ]