2-((4-Chlorobenzylidene)amino)-N-(2-(2-(4-chlorobenzylidene)hydrazinyl)-2-oxoethyl)benzamide

ID: ALA4063060

PubChem CID: 137634600

Max Phase: Preclinical

Molecular Formula: C23H18Cl2N4O2

Molecular Weight: 453.33

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CNC(=O)c1ccccc1/N=C/c1ccc(Cl)cc1)N/N=C\c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C23H18Cl2N4O2/c24-18-9-5-16(6-10-18)13-26-21-4-2-1-3-20(21)23(31)27-15-22(30)29-28-14-17-7-11-19(25)12-8-17/h1-14H,15H2,(H,27,31)(H,29,30)/b26-13+,28-14-

Standard InChI Key:  FAMOVEOZQKXBMS-TYBVMAERSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    2.6565   -4.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6554   -5.3388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3634   -5.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3616   -4.1104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0702   -4.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0691   -5.3363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7774   -4.1061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4857   -4.5138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7763   -3.2889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1928   -4.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9011   -4.5119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6082   -4.1023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9022   -5.3291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3165   -4.5100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0237   -4.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0226   -3.2832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7304   -2.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7297   -2.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0209   -1.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3114   -2.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3156   -2.8811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0187   -0.8349    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.7774   -5.7439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7786   -6.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4869   -6.9687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4835   -7.7850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1910   -8.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8991   -7.7829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8953   -6.9614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1872   -6.5576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6079   -8.1895    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
  6 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4063060

    ---

Associated Targets(non-human)

Leishmania aethiopica (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 453.33Molecular Weight (Monoisotopic): 452.0807AlogP: 4.62#Rotatable Bonds: 7
Polar Surface Area: 82.92Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.70CX Basic pKa: 1.34CX LogP: 4.94CX LogD: 4.94
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.40Np Likeness Score: -1.54

References

1. Khattab SN, Haiba NS, Asal AM, Bekhit AA, Guemei AA, Amer A, El-Faham A..  (2017)  Study of antileishmanial activity of 2-aminobenzoyl amino acid hydrazides and their quinazoline derivatives.,  27  (4): [PMID:28087274] [10.1016/j.bmcl.2017.01.003]

Source