5-amino-N-(4-chlorophenyl)-6-cyano-2-(4-methoxybenzyl)-7-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide

ID: ALA4063103

PubChem CID: 137636452

Max Phase: Preclinical

Molecular Formula: C29H23ClN6O3

Molecular Weight: 539.00

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(Cc2nn3c(-c4ccc(OC)cc4)c(C#N)c(N)nc3c2C(=O)Nc2ccc(Cl)cc2)cc1

Standard InChI:  InChI=1S/C29H23ClN6O3/c1-38-21-11-3-17(4-12-21)15-24-25(29(37)33-20-9-7-19(30)8-10-20)28-34-27(32)23(16-31)26(36(28)35-24)18-5-13-22(39-2)14-6-18/h3-14H,15H2,1-2H3,(H2,32,34)(H,33,37)

Standard InChI Key:  VTDHPZFPARKHDI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   13.0462  -19.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0462  -20.0996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7514  -20.5041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7514  -18.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4567  -19.2824    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4567  -20.1006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2348  -20.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7159  -19.6916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2349  -19.0297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5331  -19.6916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4873  -21.1307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7514  -18.0525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3391  -20.5092    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9417  -18.9839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7572  -18.9860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1657  -18.2791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7571  -17.5705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9356  -17.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5308  -18.2805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9404  -21.7380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2866  -21.3007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1929  -22.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6436  -23.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8955  -23.8967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6956  -24.0673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2434  -23.4552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9886  -22.6809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9491  -24.8442    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   14.4612  -17.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4616  -16.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7533  -16.4195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0433  -16.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0464  -17.6476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7522  -15.6023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4594  -15.1928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1647  -16.8622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9819  -16.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3373  -18.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6284  -18.4694    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
  7 11  1  0
  4 12  1  0
  2 13  1  0
 10 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 11 20  1  0
 11 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 12 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 12  1  0
 31 34  1  0
 34 35  1  0
 17 36  1  0
 36 37  1  0
  1 38  1  0
 38 39  3  0
M  END

Alternative Forms

  1. Parent:

    ALA4063103

    ---

Associated Targets(non-human)

Ehrlich (1318 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 539.00Molecular Weight (Monoisotopic): 538.1520AlogP: 5.36#Rotatable Bonds: 7
Polar Surface Area: 127.56Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.71CX Basic pKa: 1.03CX LogP: 5.19CX LogD: 5.19
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.29Np Likeness Score: -1.23

References

1. Cherukupalli S, Karpoormath R, Chandrasekaran B, Hampannavar GA, Thapliyal N, Palakollu VN..  (2017)  An insight on synthetic and medicinal aspects of pyrazolo[1,5-a]pyrimidine scaffold.,  126  [PMID:27894044] [10.1016/j.ejmech.2016.11.019]

Source