The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-amino-N-(4-chlorophenyl)-6-cyano-2-(4-methoxybenzyl)-7-(4-methoxyphenyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide ID: ALA4063103
PubChem CID: 137636452
Max Phase: Preclinical
Molecular Formula: C29H23ClN6O3
Molecular Weight: 539.00
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cc2nn3c(-c4ccc(OC)cc4)c(C#N)c(N)nc3c2C(=O)Nc2ccc(Cl)cc2)cc1
Standard InChI: InChI=1S/C29H23ClN6O3/c1-38-21-11-3-17(4-12-21)15-24-25(29(37)33-20-9-7-19(30)8-10-20)28-34-27(32)23(16-31)26(36(28)35-24)18-5-13-22(39-2)14-6-18/h3-14H,15H2,1-2H3,(H2,32,34)(H,33,37)
Standard InChI Key: VTDHPZFPARKHDI-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
13.0462 -19.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0462 -20.0996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7514 -20.5041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7514 -18.8697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4567 -19.2824 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4567 -20.1006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2348 -20.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7159 -19.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2349 -19.0297 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5331 -19.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4873 -21.1307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7514 -18.0525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3391 -20.5092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9417 -18.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7572 -18.9860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1657 -18.2791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7571 -17.5705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9356 -17.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5308 -18.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9404 -21.7380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2866 -21.3007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1929 -22.5152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6436 -23.1201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8955 -23.8967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6956 -24.0673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2434 -23.4552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9886 -22.6809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9491 -24.8442 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.4612 -17.6453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4616 -16.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7533 -16.4195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0433 -16.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0464 -17.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7522 -15.6023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4594 -15.1928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1647 -16.8622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9819 -16.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3373 -18.8759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6284 -18.4694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
7 11 1 0
4 12 1 0
2 13 1 0
10 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
11 20 1 0
11 21 2 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
12 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 12 1 0
31 34 1 0
34 35 1 0
17 36 1 0
36 37 1 0
1 38 1 0
38 39 3 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 539.00Molecular Weight (Monoisotopic): 538.1520AlogP: 5.36#Rotatable Bonds: 7Polar Surface Area: 127.56Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.71CX Basic pKa: 1.03CX LogP: 5.19CX LogD: 5.19Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.29Np Likeness Score: -1.23
References 1. Cherukupalli S, Karpoormath R, Chandrasekaran B, Hampannavar GA, Thapliyal N, Palakollu VN.. (2017) An insight on synthetic and medicinal aspects of pyrazolo[1,5-a]pyrimidine scaffold., 126 [PMID:27894044 ] [10.1016/j.ejmech.2016.11.019 ]