The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-(4-(benzyloxy)-2-hydroxybenzylidene)-6-((3(diethylamino)propyl)amino)-7-fluoro-2,3-dihydropyrrolo[2,1-b]quinazolin-9(1H)-one ID: ALA4063228
PubChem CID: 137634400
Max Phase: Preclinical
Molecular Formula: C32H35FN4O3
Molecular Weight: 542.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCCNc1cc2nc3n(c(=O)c2cc1F)CC/C3=C\c1ccc(OCc2ccccc2)cc1O
Standard InChI: InChI=1S/C32H35FN4O3/c1-3-36(4-2)15-8-14-34-29-20-28-26(19-27(29)33)32(39)37-16-13-24(31(37)35-28)17-23-11-12-25(18-30(23)38)40-21-22-9-6-5-7-10-22/h5-7,9-12,17-20,34,38H,3-4,8,13-16,21H2,1-2H3/b24-17+
Standard InChI Key: AMUODZMAMRKDBR-JJIBRWJFSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
10.5422 -7.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7936 -7.8330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5898 -8.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8417 -8.7821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6413 -8.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1871 -8.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9373 -7.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1413 -7.3987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9365 -5.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9353 -6.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6475 -7.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6457 -5.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3502 -5.9808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3532 -6.8015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0552 -7.2064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0575 -5.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0576 -4.7562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2232 -7.2161 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5075 -6.8070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8036 -7.2192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7664 -5.9833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7690 -6.8015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0228 -6.3969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5448 -5.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2214 -5.5742 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.0934 -6.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3882 -7.2278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6780 -6.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3932 -8.0450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6730 -6.0064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1034 -8.4492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9859 -8.5251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5348 -7.9198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2937 -9.3883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3335 -8.0925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5792 -8.8697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3771 -9.0427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9270 -8.4370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6734 -7.6556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8761 -7.4864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
9 10 2 0
10 11 1 0
11 14 2 0
13 12 2 0
12 9 1 0
13 14 1 0
13 16 1 0
14 15 1 0
15 22 2 0
21 16 1 0
16 17 2 0
10 18 1 0
18 19 1 0
19 20 1 0
21 22 1 0
22 1 1 0
1 23 1 0
23 24 1 0
24 21 1 0
9 25 1 0
20 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
28 30 1 0
29 31 1 0
6 32 1 0
32 33 1 0
4 34 1 0
33 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 542.66Molecular Weight (Monoisotopic): 542.2693AlogP: 5.91#Rotatable Bonds: 11Polar Surface Area: 79.62Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.08CX Basic pKa: 10.00CX LogP: 3.88CX LogD: 2.53Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.23Np Likeness Score: -0.95
References 1. Wang YQ, Huang ZL, Chen SB, Wang CX, Shan C, Yin QK, Ou TM, Li D, Gu LQ, Tan JH, Huang ZS.. (2017) Design, Synthesis, and Evaluation of New Selective NM23-H2 Binders as c-MYC Transcription Inhibitors via Disruption of the NM23-H2/G-Quadruplex Interaction., 60 (16): [PMID:28714689 ] [10.1021/acs.jmedchem.7b00421 ]