7-((1r,4r)-4-(3-methyl-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl)cyclohexyl)-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine

ID: ALA4063307

PubChem CID: 118105350

Max Phase: Preclinical

Molecular Formula: C30H32N8O

Molecular Weight: 520.64

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nnc2n1CCN([C@H]1CC[C@H](n3cc(-c4ccc(Oc5ccccc5)cc4)c4c(N)ncnc43)CC1)C2

Standard InChI:  InChI=1S/C30H32N8O/c1-20-34-35-27-18-36(15-16-37(20)27)22-9-11-23(12-10-22)38-17-26(28-29(31)32-19-33-30(28)38)21-7-13-25(14-8-21)39-24-5-3-2-4-6-24/h2-8,13-14,17,19,22-23H,9-12,15-16,18H2,1H3,(H2,31,32,33)/t22-,23-

Standard InChI Key:  XCUPLDCBIYZDPC-YHBQERECSA-N

Molfile:  

     RDKit          2D

 39 45  0  0  0  0  0  0  0  0999 V2000
    2.6978  -20.3637    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6966  -21.1874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4047  -21.6005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4029  -19.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1156  -20.3601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1205  -21.1874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9090  -21.4413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3931  -20.7684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9012  -20.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1532  -19.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9549  -19.1493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2030  -18.3674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6482  -17.7582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8422  -17.9363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5979  -18.7180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1680  -22.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6185  -22.8288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8725  -23.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6765  -23.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2259  -23.1655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9715  -22.3820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9339  -24.5507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8951  -16.9751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6974  -16.7994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2511  -17.4076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0526  -17.2283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3002  -16.4445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7443  -15.8398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9448  -16.0181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4005  -19.1335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3854  -25.1554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6358  -25.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7306  -24.7150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9813  -25.4898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4381  -26.0966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8489  -26.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6435  -26.6290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7252  -25.8204    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5148  -27.5515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 16  7  1  1
 19 22  1  6
 13 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  4 30  1  0
 22 31  1  0
 22 33  1  0
 31 32  1  0
 32 35  1  0
 34 33  1  0
 34 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 34  2  0
 36 39  1  0
M  END

Associated Targets(Human)

HCK Tclin Tyrosine-protein kinase HCK (2743 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 520.64Molecular Weight (Monoisotopic): 520.2699AlogP: 5.37#Rotatable Bonds: 5
Polar Surface Area: 99.91Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 6.99CX LogP: 3.67CX LogD: 3.52
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.33Np Likeness Score: -0.74

References

1. Yuki H, Kikuzato K, Koda Y, Mikuni J, Tomabechi Y, Kukimoto-Niino M, Tanaka A, Shirai F, Shirouzu M, Koyama H, Honma T..  (2017)  Activity cliff for 7-substituted pyrrolo-pyrimidine inhibitors of HCK explained in terms of predicted basicity of the amine nitrogen.,  25  (16): [PMID:28662963] [10.1016/j.bmc.2017.05.053]

Source