2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl 2-naphthoate

ID: ALA4063319

PubChem CID: 78805530

Max Phase: Preclinical

Molecular Formula: C17H15N3O4

Molecular Weight: 325.32

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1ccc2ccccc2c1

Standard InChI:  InChI=1S/C17H15N3O4/c1-12-18-11-16(20(22)23)19(12)8-9-24-17(21)15-7-6-13-4-2-3-5-14(13)10-15/h2-7,10-11H,8-9H2,1H3

Standard InChI Key:  SHYYVRSTNCZLSM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   28.1548  -10.3430    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.8134   -9.8495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5521   -9.0710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7283   -9.0860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4853   -9.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1650  -11.1642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6000  -10.0962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2045   -9.5377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.7799  -10.8975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8818  -11.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8919  -12.3894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.6088  -12.7892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6189  -13.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3155  -12.3718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7076  -10.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9114  -14.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9212  -14.8474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3344  -14.0072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3476  -14.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6401  -15.2430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6503  -16.0628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3673  -16.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0754  -16.0409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0618  -15.2225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  2  7  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  5 15  1  0
 13 16  2  0
 16 17  1  0
 17 20  2  0
 19 18  2  0
 18 13  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
M  CHG  2   7   1   9  -1
M  END

Associated Targets(non-human)

GUSB Beta-glucuronidase (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 325.32Molecular Weight (Monoisotopic): 325.1063AlogP: 3.11#Rotatable Bonds: 5
Polar Surface Area: 87.26Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.27CX LogP: 3.03CX LogD: 3.03
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.41Np Likeness Score: -1.31

References

1. Salar U, Khan KM, Taha M, Ismail NH, Ali B, Qurat-Ul-Ain, Perveen S, Ghufran M, Wadood A..  (2017)  Biology-oriented drug synthesis (BIODS): In vitro β-glucuronidase inhibitory and in silico studies on 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl aryl carboxylate derivatives.,  125  [PMID:27886546] [10.1016/j.ejmech.2016.11.031]

Source