The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Chloro-4-{4-[5-(3-{[glycyl(methyl)amino]methyl}phenyl)pyrimidin-2-yl]piperazin-1-yl}benzoic acid dihydrochloride ID: ALA4063342
PubChem CID: 68107525
Max Phase: Preclinical
Molecular Formula: C25H29Cl3N6O3
Molecular Weight: 494.98
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(Cc1cccc(-c2cnc(N3CCN(c4ccc(C(=O)O)cc4Cl)CC3)nc2)c1)C(=O)CN.Cl.Cl
Standard InChI: InChI=1S/C25H27ClN6O3.2ClH/c1-30(23(33)13-27)16-17-3-2-4-18(11-17)20-14-28-25(29-15-20)32-9-7-31(8-10-32)22-6-5-19(24(34)35)12-21(22)26;;/h2-6,11-12,14-15H,7-10,13,16,27H2,1H3,(H,34,35);2*1H
Standard InChI Key: HWXBGKVIURAJOO-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
12.2909 -11.7773 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.5447 -13.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2518 -12.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9587 -13.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6659 -12.9091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6620 -12.0919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9551 -11.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2479 -12.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8336 -12.9143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5444 -14.1409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3691 -11.6799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0760 -12.0852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7831 -11.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7834 -10.8560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0723 -10.4508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3652 -10.8628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4905 -10.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1974 -10.8534 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9045 -10.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9006 -9.6242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1896 -9.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4866 -9.6310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6078 -9.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3147 -9.6216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0218 -9.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0221 -8.3925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3110 -7.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6039 -8.3951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7329 -9.6149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4359 -9.2070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4361 -8.3898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1469 -9.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4437 -10.8414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1508 -10.4294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8540 -9.2003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3728 -13.3143 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.1611 -11.9485 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
3 8 2 0
2 9 2 0
2 10 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
11 16 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
23 28 2 0
30 31 1 0
33 34 1 0
32 34 1 0
32 35 2 0
30 32 1 0
29 30 1 0
25 29 1 0
20 23 1 0
14 17 1 0
6 11 1 0
5 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.98Molecular Weight (Monoisotopic): 494.1833AlogP: 2.74#Rotatable Bonds: 7Polar Surface Area: 115.89Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.54CX Basic pKa: 8.13CX LogP: 0.47CX LogD: 0.41Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.51Np Likeness Score: -1.42
References 1. Yamaki S, Koga Y, Nagashima A, Kondo M, Shimada Y, Kadono K, Moritomo A, Yoshihara K.. (2017) Synthesis and pharmacological evaluation of glycine amide derivatives as novel vascular adhesion protein-1 inhibitors without CYP3A4 and CYP2C19 inhibition., 25 (15): [PMID:28601507 ] [10.1016/j.bmc.2017.05.059 ]