(S)-4-benzyl-1-(4-((S)-2-(3-fluorobenzyl)-4,5-dihydro-1H-imidazol-4-yl)butyl)-3-phenethylimidazolidine-2-thione

ID: ALA4063381

PubChem CID: 137636466

Max Phase: Preclinical

Molecular Formula: C32H37FN4S

Molecular Weight: 528.74

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Fc1cccc(CC2=N[C@@H](CCCCN3C[C@H](Cc4ccccc4)N(CCc4ccccc4)C3=S)CN2)c1

Standard InChI:  InChI=1S/C32H37FN4S/c33-28-15-9-14-27(20-28)22-31-34-23-29(35-31)16-7-8-18-36-24-30(21-26-12-5-2-6-13-26)37(32(36)38)19-17-25-10-3-1-4-11-25/h1-6,9-15,20,29-30H,7-8,16-19,21-24H2,(H,34,35)/t29-,30-/m0/s1

Standard InChI Key:  YABDGLYIQKEODM-KYJUHHDHSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   17.5873   -9.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7556  -10.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5323  -10.4182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7007  -11.2178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4774  -11.4718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7270  -12.2491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5442  -12.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7983  -11.4739    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1380  -10.9924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1390  -10.1752    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.0233  -12.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6276  -13.6280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8134  -13.6387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4179  -14.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8394  -15.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6606  -15.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0524  -14.3217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5759  -11.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1822  -11.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9439  -11.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5794  -11.9872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3405  -11.6918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4656  -10.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8235  -10.3711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0649  -10.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8106   -9.1104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5582   -8.3376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7410   -8.3360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4870   -9.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1472   -9.5942    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7093   -9.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5379  -10.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7594  -10.4094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5878  -11.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1944  -11.7564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9753  -11.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1432  -10.7039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8100  -11.4583    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  2  0
  7 11  1  1
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  8 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 26  1  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 26  1  0
 29 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 34 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4063381

    ---

Associated Targets(Human)

RORA Tchem Nuclear receptor ROR-alpha (562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorb Nuclear receptor ROR-beta (15 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 528.74Molecular Weight (Monoisotopic): 528.2723AlogP: 5.67#Rotatable Bonds: 12
Polar Surface Area: 30.87Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.80CX LogP: 6.59CX LogD: 4.48
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -0.48

References

1. Nefzi A, Marconi GD, Ortiz MA, Davis JC, Piedrafita FJ..  (2017)  Synthesis of dihydroimidazole tethered imidazolinethiones and their activity as novel antagonists of the nuclear retinoic acid receptor-related orphan receptors (RORs).,  27  (7): [PMID:28242276] [10.1016/j.bmcl.2017.02.014]

Source