7-(difluoro(6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)methyl)quinoline

ID: ALA4063423

PubChem CID: 137634411

Max Phase: Preclinical

Molecular Formula: C20H11F3N6

Molecular Weight: 392.34

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Fc1ccc(-c2cnc3nnc(C(F)(F)c4ccc5cccnc5c4)n3n2)cc1

Standard InChI:  InChI=1S/C20H11F3N6/c21-15-7-4-13(5-8-15)17-11-25-19-27-26-18(29(19)28-17)20(22,23)14-6-3-12-2-1-9-24-16(12)10-14/h1-11H

Standard InChI Key:  UVKFBYOTEJFDJX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   17.6480  -11.6223    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.4405  -11.8369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2301  -11.0433    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.8547   -9.3812    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2712  -10.2002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2684   -9.3776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5598   -8.9723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5616  -10.6097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8535  -10.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1474  -10.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1482  -11.4267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8609  -11.8338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5641  -11.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4439  -12.6545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8594  -13.9090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1096  -13.1311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0421  -13.9113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7915  -13.1357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9988  -12.9659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4513  -13.5689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7019  -14.3445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5002  -14.5171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6568  -13.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4075  -12.6198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6095  -12.4474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0600  -13.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3140  -13.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1115  -14.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2609  -12.8823    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  9  2  0
  8  5  2  0
  5  6  1  0
  6  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 11  2  1  0
  2 14  1  0
 14 18  1  0
 17 15  2  0
 15 16  1  0
 16 14  2  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 20 23  1  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4063423

    ---

Associated Targets(Human)

AOX1 Tchem Aldehyde oxidase (429 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.34Molecular Weight (Monoisotopic): 392.0997AlogP: 4.01#Rotatable Bonds: 3
Polar Surface Area: 68.86Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.96CX LogP: 3.80CX LogD: 3.80
Aromatic Rings: 5Heavy Atoms: 29QED Weighted: 0.46Np Likeness Score: -1.58

References

1. Xu Y, Li L, Wang Y, Xing J, Zhou L, Zhong D, Luo X, Jiang H, Chen K, Zheng M, Deng P, Chen X..  (2017)  Aldehyde Oxidase Mediated Metabolism in Drug-like Molecules: A Combined Computational and Experimental Study.,  60  (7): [PMID:28263602] [10.1021/acs.jmedchem.7b00019]

Source