(5-(3-Chloro-4-hydroxy-phenyl)-thiophen-2-yl)-(2,6-difluoro-3-hydroxy-phenyl)-methanone

ID: ALA4063839

PubChem CID: 122653002

Max Phase: Preclinical

Molecular Formula: C17H9ClF2O3S

Molecular Weight: 366.77

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccc(-c2ccc(O)c(Cl)c2)s1)c1c(F)ccc(O)c1F

Standard InChI:  InChI=1S/C17H9ClF2O3S/c18-9-7-8(1-3-11(9)21)13-5-6-14(24-13)17(23)15-10(19)2-4-12(22)16(15)20/h1-7,21-22H

Standard InChI Key:  MHGINHFUACJCCL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   24.1924  -16.4470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1913  -17.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8993  -17.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6090  -17.2660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6061  -16.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8975  -16.0381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8951  -15.2209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6016  -14.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1861  -14.8144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3536  -15.1403    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   26.8986  -14.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4879  -13.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6891  -13.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7074  -14.6118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0412  -15.3589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8534  -15.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3326  -14.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9939  -14.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1827  -13.9512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3123  -16.0321    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.4846  -16.0385    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.4832  -17.6745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.1877  -16.1879    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   30.1457  -14.8611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  8  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 11 14  1  0
  5 20  1  0
  1 21  1  0
  2 22  1  0
 16 23  1  0
 17 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4063839

    ---

Associated Targets(Human)

HSD17B1 Tchem Estradiol 17-beta-dehydrogenase 1 (2224 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HSD17B2 Tchem Estradiol 17-beta-dehydrogenase 2 (1671 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ESR1 Tclin Estrogen receptor alpha (17718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ESR2 Tclin Estrogen receptor beta (9272 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 366.77Molecular Weight (Monoisotopic): 365.9929AlogP: 4.99#Rotatable Bonds: 3
Polar Surface Area: 57.53Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.31CX Basic pKa: CX LogP: 5.27CX LogD: 4.86
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.64Np Likeness Score: -0.80

References

1. Abdelsamie AS, van Koppen CJ, Bey E, Salah M, Börger C, Siebenbürger L, Laschke MW, Menger MD, Frotscher M..  (2017)  Treatment of estrogen-dependent diseases: Design, synthesis and profiling of a selective 17β-HSD1 inhibitor with sub-nanomolar IC50 for a proof-of-principle study.,  127  [PMID:27852458] [10.1016/j.ejmech.2016.11.004]

Source