4-cyano-N-(1,3-dimethyl-2-oxo-1,2-dihydroquinolin-6-yl)-N-ethyl-2-methoxybenzenesulfonamide

ID: ALA4064386

PubChem CID: 137636753

Max Phase: Preclinical

Molecular Formula: C21H21N3O4S

Molecular Weight: 411.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(c1ccc2c(c1)cc(C)c(=O)n2C)S(=O)(=O)c1ccc(C#N)cc1OC

Standard InChI:  InChI=1S/C21H21N3O4S/c1-5-24(29(26,27)20-9-6-15(13-22)11-19(20)28-4)17-7-8-18-16(12-17)10-14(2)21(25)23(18)3/h6-12H,5H2,1-4H3

Standard InChI Key:  QFFNGUVYHVBZQM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    6.4343  -15.9682    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0299  -15.2625    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.6209  -15.9656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7439  -14.8498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4565  -15.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4553  -16.0861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1675  -16.4951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1657  -14.8495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8785  -15.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8773  -16.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5876  -16.4927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2995  -16.0856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3007  -15.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5900  -14.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0102  -16.4962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5854  -17.3140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3209  -14.8502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3203  -14.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6195  -13.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9071  -14.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9041  -14.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6094  -15.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2019  -13.6130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4968  -13.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7442  -14.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0102  -14.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6059  -16.0795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8964  -16.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0367  -13.6237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  6  2  0
  6  7  1  0
  7 10  2  0
  9  8  2  0
  8  5  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 12 15  2  0
 11 16  1  0
  5  4  1  0
  4  2  1  0
  2 17  1  0
 17 18  1  0
 17 22  2  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 20 23  1  0
 23 24  3  0
  4 25  1  0
 13 26  1  0
 22 27  1  0
 27 28  1  0
 25 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4064386

    ---

Associated Targets(Human)

BRPF1 Tchem Peregrin (2217 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.48Molecular Weight (Monoisotopic): 411.1253AlogP: 2.94#Rotatable Bonds: 5
Polar Surface Area: 92.40Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.62CX LogD: 2.62
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.64Np Likeness Score: -1.61

References

1. Igoe N, Bayle ED, Tallant C, Fedorov O, Meier JC, Savitsky P, Rogers C, Morias Y, Scholze S, Boyd H, Cunoosamy D, Andrews DM, Cheasty A, Brennan PE, Müller S, Knapp S, Fish PV..  (2017)  Design of a Chemical Probe for the Bromodomain and Plant Homeodomain Finger-Containing (BRPF) Family of Proteins.,  60  (16): [PMID:28714688] [10.1021/acs.jmedchem.7b00611]

Source