(S)-3-(2-ethyl-4-(5-(2-methoxy-6-(pentan-3-yl)pyridin-4-yl)-1,2,4-oxadiazol-3-yl)-6-methylphenoxy)propane-1,2-diol

ID: ALA4064517

PubChem CID: 49871885

Max Phase: Preclinical

Molecular Formula: C25H33N3O5

Molecular Weight: 455.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1cc(-c2noc(-c3cc(OC)nc(C(CC)CC)c3)n2)cc(C)c1OC[C@@H](O)CO

Standard InChI:  InChI=1S/C25H33N3O5/c1-6-16(7-2)21-11-19(12-22(26-21)31-5)25-27-24(28-33-25)18-9-15(4)23(17(8-3)10-18)32-14-20(30)13-29/h9-12,16,20,29-30H,6-8,13-14H2,1-5H3/t20-/m0/s1

Standard InChI Key:  RSGHIJYQEOTUNA-FQEVSTJZSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    7.3906  -25.6862    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6108  -25.4288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1223  -26.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6026  -26.7552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3854  -26.5074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0480  -26.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9561  -27.8062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6135  -28.2945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3671  -27.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4595  -27.1460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7971  -26.6613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3045  -26.0821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9010  -25.3662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0804  -25.3607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6625  -26.0706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0752  -26.7873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8944  -26.7892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6653  -27.4943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8482  -27.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6772  -24.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0911  -23.9454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9083  -23.9515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2079  -26.8176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5202  -29.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7705  -29.4315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0244  -28.4524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7736  -28.1261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4308  -28.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1800  -28.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3388  -29.4237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2720  -27.4733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8600  -24.6438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4568  -23.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  5  6  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  3 12  1  0
 16 18  1  0
 18 19  1  0
 14 20  1  0
 20 21  1  0
 21 22  1  0
 10 23  1  0
  8 24  1  0
 24 25  1  0
  9 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  6
 29 31  1  0
 20 32  1  0
 32 33  1  0
M  END

Associated Targets(non-human)

Trachea (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 455.56Molecular Weight (Monoisotopic): 455.2420AlogP: 4.31#Rotatable Bonds: 11
Polar Surface Area: 110.73Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.62CX Basic pKa: 0.62CX LogP: 5.52CX LogD: 5.52
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.44Np Likeness Score: -0.44

References

1. Dyckman AJ..  (2017)  Modulators of Sphingosine-1-phosphate Pathway Biology: Recent Advances of Sphingosine-1-phosphate Receptor 1 (S1P1) Agonists and Future Perspectives.,  60  (13): [PMID:28291340] [10.1021/acs.jmedchem.6b01575]

Source