The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(6-Methyl-3-(phenylthio)pyrido[2,3-b]pyrazin-7-yl)-3-(trifluoromethyl)benzamide ID: ALA4064523
PubChem CID: 137637185
Max Phase: Preclinical
Molecular Formula: C22H15F3N4OS
Molecular Weight: 440.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc2nc(Sc3ccccc3)cnc2cc1NC(=O)c1cccc(C(F)(F)F)c1
Standard InChI: InChI=1S/C22H15F3N4OS/c1-13-17(28-21(30)14-6-5-7-15(10-14)22(23,24)25)11-18-20(27-13)29-19(12-26-18)31-16-8-3-2-4-9-16/h2-12H,1H3,(H,28,30)
Standard InChI Key: VLBRGBSHXNCBHZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
26.8927 -20.4944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6024 -20.0849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5996 -19.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8910 -18.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1847 -20.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1870 -19.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4810 -18.8586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7724 -19.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7740 -20.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4806 -20.4924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3108 -20.4924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3057 -18.8510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.0673 -20.4973 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.3566 -20.1138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3601 -19.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6522 -18.8919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9445 -19.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9491 -20.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6575 -20.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0150 -19.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7212 -18.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0181 -20.0741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4288 -19.2550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1345 -18.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1319 -18.0264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4176 -17.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7149 -18.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4117 -16.8034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1164 -16.3897 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.7010 -16.4000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.4053 -15.9848 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
2 11 1 0
3 12 1 0
9 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
12 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
26 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.45Molecular Weight (Monoisotopic): 440.0919AlogP: 5.76#Rotatable Bonds: 4Polar Surface Area: 67.77Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.78CX LogP: 5.29CX LogD: 5.29Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.44Np Likeness Score: -1.57
References 1. Argyros O, Lougiakis N, Kouvari E, Papafotika A, Raptopoulou CP, Psycharis V, Christoforidis S, Pouli N, Marakos P, Tamvakopoulos C.. (2017) Design and synthesis of novel 7-aminosubstituted pyrido[2,3-b]pyrazines exhibiting anti-breast cancer activity., 126 [PMID:28006668 ] [10.1016/j.ejmech.2016.12.025 ]