The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-chloro-N-(4-(3-(4-isopropylpiperazin-1-yl)prop-1-yn-1-yl)benzyl)-N-neopentyl-pyrimidin-4-amine ID: ALA4065230
PubChem CID: 137633720
Max Phase: Preclinical
Molecular Formula: C26H36ClN5
Molecular Weight: 454.06
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)N1CCN(CC#Cc2ccc(CN(CC(C)(C)C)c3ccnc(Cl)n3)cc2)CC1
Standard InChI: InChI=1S/C26H36ClN5/c1-21(2)31-17-15-30(16-18-31)14-6-7-22-8-10-23(11-9-22)19-32(20-26(3,4)5)24-12-13-28-25(27)29-24/h8-13,21H,14-20H2,1-5H3
Standard InChI Key: IXDKZEYFSRQOTF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
25.5090 -4.9320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5078 -5.7557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2200 -6.1646 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9338 -5.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9310 -4.9284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.2182 -4.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2158 -3.6977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9264 -3.2870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5027 -3.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5003 -2.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7872 -2.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2109 -2.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4939 -1.6468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6353 -3.6935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6356 -4.5121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3478 -4.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0594 -4.5078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0543 -3.6822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3415 -3.2795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7709 -4.9138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4845 -5.3194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1981 -5.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9081 -5.3132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.6157 -5.7248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3237 -5.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3244 -4.4908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.6110 -4.0831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9009 -4.4929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0360 -4.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7481 -4.4901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0356 -3.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6416 -6.1636 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
7 9 1 0
9 10 1 0
10 11 1 0
10 12 1 0
10 13 1 0
8 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
20 21 3 0
17 20 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 0
29 30 1 0
29 31 1 0
4 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.06Molecular Weight (Monoisotopic): 453.2659AlogP: 4.56#Rotatable Bonds: 6Polar Surface Area: 35.50Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.29CX LogP: 6.04CX LogD: 5.10Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -1.35
References 1. Miltz W, Velcicky J, Dawson J, Littlewood-Evans A, Ludwig MG, Seuwen K, Feifel R, Oberhauser B, Meyer A, Gabriel D, Nash M, Loetscher P.. (2017) Design and synthesis of potent and orally active GPR4 antagonists with modulatory effects on nociception, inflammation, and angiogenesis., 25 (16): [PMID:28689977 ] [10.1016/j.bmc.2017.06.050 ]