2-chloro-N-(4-(3-(4-isopropylpiperazin-1-yl)prop-1-yn-1-yl)benzyl)-N-neopentyl-pyrimidin-4-amine

ID: ALA4065230

PubChem CID: 137633720

Max Phase: Preclinical

Molecular Formula: C26H36ClN5

Molecular Weight: 454.06

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)N1CCN(CC#Cc2ccc(CN(CC(C)(C)C)c3ccnc(Cl)n3)cc2)CC1

Standard InChI:  InChI=1S/C26H36ClN5/c1-21(2)31-17-15-30(16-18-31)14-6-7-22-8-10-23(11-9-22)19-32(20-26(3,4)5)24-12-13-28-25(27)29-24/h8-13,21H,14-20H2,1-5H3

Standard InChI Key:  IXDKZEYFSRQOTF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   25.5090   -4.9320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5078   -5.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2200   -6.1646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.9338   -5.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9310   -4.9284    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.2182   -4.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2158   -3.6977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.9264   -3.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5027   -3.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5003   -2.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7872   -2.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2109   -2.0551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4939   -1.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6353   -3.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6356   -4.5121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3478   -4.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0594   -4.5078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0543   -3.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3415   -3.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7709   -4.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4845   -5.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1981   -5.7290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9081   -5.3132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6157   -5.7248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3237   -5.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3244   -4.4908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6110   -4.0831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9009   -4.4929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0360   -4.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7481   -4.4901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0356   -3.2605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6416   -6.1636    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  1  0
 10 13  1  0
  8 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  3  0
 17 20  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 26 29  1  0
 29 30  1  0
 29 31  1  0
  4 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4065230

    ---

Associated Targets(Human)

GPR4 Tchem G-protein coupled receptor 4 (124 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.06Molecular Weight (Monoisotopic): 453.2659AlogP: 4.56#Rotatable Bonds: 6
Polar Surface Area: 35.50Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.29CX LogP: 6.04CX LogD: 5.10
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -1.35

References

1. Miltz W, Velcicky J, Dawson J, Littlewood-Evans A, Ludwig MG, Seuwen K, Feifel R, Oberhauser B, Meyer A, Gabriel D, Nash M, Loetscher P..  (2017)  Design and synthesis of potent and orally active GPR4 antagonists with modulatory effects on nociception, inflammation, and angiogenesis.,  25  (16): [PMID:28689977] [10.1016/j.bmc.2017.06.050]

Source