The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-isopropyl Englerin A ID: ALA4065494
PubChem CID: 137633910
Max Phase: Preclinical
Molecular Formula: C28H38O6
Molecular Weight: 470.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@@H]1CC[C@@H]2[C@@H]1[C@H](OC(=O)/C=C/c1ccccc1)[C@@]1(C(C)C)C[C@@H](OC(=O)CO)[C@]2(C)O1
Standard InChI: InChI=1S/C28H38O6/c1-17(2)20-12-13-21-25(20)26(33-23(30)14-11-19-9-7-6-8-10-19)28(18(3)4)15-22(27(21,5)34-28)32-24(31)16-29/h6-11,14,17-18,20-22,25-26,29H,12-13,15-16H2,1-5H3/b14-11+/t20-,21+,22+,25+,26-,27+,28-/m0/s1
Standard InChI Key: DBUNANQJITZEGC-KOEOTPNQSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
10.3037 -9.5518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3861 -9.6963 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.2246 -11.0802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8139 -10.2159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7924 -11.6976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0104 -10.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1218 -12.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3563 -10.5231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1277 -13.7762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9736 -8.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3464 -11.3472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8398 -9.2129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2968 -12.3506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3303 -9.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0832 -10.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0932 -12.1312 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.1235 -9.6441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5595 -11.5923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5757 -10.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1633 -10.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5315 -11.6312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9850 -11.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5373 -13.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7669 -12.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2760 -8.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7190 -7.9176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0724 -8.3322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9584 -7.1363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4013 -6.5383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6434 -5.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0872 -5.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2899 -5.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0518 -6.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6097 -6.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8845 -8.8707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5331 -9.2916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 18 1 0
22 3 1 0
6 12 1 6
22 24 1 6
7 23 1 0
8 2 1 6
5 13 1 1
8 6 1 0
11 22 1 0
11 16 1 1
1 17 1 0
4 20 1 0
3 4 1 0
19 15 1 0
22 5 1 0
4 1 1 6
20 5 1 0
23 9 1 0
1 10 1 0
11 8 1 0
7 21 2 0
18 11 1 0
13 7 1 0
6 4 1 0
19 14 1 1
8 19 1 0
12 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
14 35 1 0
14 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.61Molecular Weight (Monoisotopic): 470.2668AlogP: 4.40#Rotatable Bonds: 7Polar Surface Area: 82.06Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.13CX Basic pKa: ┄CX LogP: 5.11CX LogD: 5.11Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: 2.30