4-isopropyl Englerin A

ID: ALA4065494

PubChem CID: 137633910

Max Phase: Preclinical

Molecular Formula: C28H38O6

Molecular Weight: 470.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)[C@@H]1CC[C@@H]2[C@@H]1[C@H](OC(=O)/C=C/c1ccccc1)[C@@]1(C(C)C)C[C@@H](OC(=O)CO)[C@]2(C)O1

Standard InChI:  InChI=1S/C28H38O6/c1-17(2)20-12-13-21-25(20)26(33-23(30)14-11-19-9-7-6-8-10-19)28(18(3)4)15-22(27(21,5)34-28)32-24(31)16-29/h6-11,14,17-18,20-22,25-26,29H,12-13,15-16H2,1-5H3/b14-11+/t20-,21+,22+,25+,26-,27+,28-/m0/s1

Standard InChI Key:  DBUNANQJITZEGC-KOEOTPNQSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   10.3037   -9.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3861   -9.6963    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2246  -11.0802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8139  -10.2159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7924  -11.6976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0104  -10.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1218  -12.3473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3563  -10.5231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1277  -13.7762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9736   -8.7958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3464  -11.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8398   -9.2129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2968  -12.3506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3303   -9.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0832  -10.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0932  -12.1312    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.1235   -9.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5595  -11.5923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5757  -10.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1633  -10.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5315  -11.6312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9850  -11.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5373  -13.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7669  -12.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2760   -8.5156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7190   -7.9176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0724   -8.3322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9584   -7.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4013   -6.5383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6434   -5.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0872   -5.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2899   -5.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0518   -6.1295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6097   -6.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8845   -8.8707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5331   -9.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 15 18  1  0
 22  3  1  0
  6 12  1  6
 22 24  1  6
  7 23  1  0
  8  2  1  6
  5 13  1  1
  8  6  1  0
 11 22  1  0
 11 16  1  1
  1 17  1  0
  4 20  1  0
  3  4  1  0
 19 15  1  0
 22  5  1  0
  4  1  1  6
 20  5  1  0
 23  9  1  0
  1 10  1  0
 11  8  1  0
  7 21  2  0
 18 11  1  0
 13  7  1  0
  6  4  1  0
 19 14  1  1
  8 19  1  0
 12 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 14 35  1  0
 14 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4065494

    ---

Associated Targets(Human)

Hs-578T (29457 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
UO-31 (46270 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ACHN (49357 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A498 (42825 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.61Molecular Weight (Monoisotopic): 470.2668AlogP: 4.40#Rotatable Bonds: 7
Polar Surface Area: 82.06Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.13CX Basic pKa: CX LogP: 5.11CX LogD: 5.11
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: 2.30

References

1. Elliott DC, Beutler JA, Parker KA..  (2017)  Importance of a 4-Alkyl Substituent for Activity in the Englerin Series.,  (7): [PMID:28740610] [10.1021/acsmedchemlett.7b00161]

Source