1-Cyclohexyl-N-((1-(2-(3-methoxyphenyl)pyridin-4-yl)-1H-indol-3-yl)methyl)methanamine

ID: ALA4065531

PubChem CID: 137632407

Max Phase: Preclinical

Molecular Formula: C28H31N3O

Molecular Weight: 425.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(-c2cc(-n3cc(CNCC4CCCCC4)c4ccccc43)ccn2)c1

Standard InChI:  InChI=1S/C28H31N3O/c1-32-25-11-7-10-22(16-25)27-17-24(14-15-30-27)31-20-23(26-12-5-6-13-28(26)31)19-29-18-21-8-3-2-4-9-21/h5-7,10-17,20-21,29H,2-4,8-9,18-19H2,1H3

Standard InChI Key:  BDOPTJCWJMOEHW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    6.4358  -16.7307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8507  -15.4567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1843  -15.9457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5173  -15.9457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2597  -16.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8086  -17.3383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6153  -17.1713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8700  -16.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3194  -15.7779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8495  -14.6312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5620  -14.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5611  -13.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8485  -12.9803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1311  -13.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1355  -14.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9530  -17.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1318  -17.3099    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6449  -17.9788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8236  -17.8931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4929  -17.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6754  -17.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1849  -17.7160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5178  -18.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3413  -18.5619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4171  -12.9867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4143  -12.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6975  -11.7527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9828  -12.1672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9897  -12.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7071  -13.4046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6938  -10.9270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4075  -10.5088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  1  0
  4  2  1  0
  2  3  1  0
  3  1  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  2 10  1  0
  1 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 14 25  1  0
 27 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4065531

    ---

Associated Targets(Human)

WNK1 Tchem Serine/threonine-protein kinase WNK1 (297 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.58Molecular Weight (Monoisotopic): 425.2467AlogP: 6.37#Rotatable Bonds: 7
Polar Surface Area: 39.08Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.93CX LogP: 6.28CX LogD: 3.72
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.37Np Likeness Score: -0.93

References

1. Yamada K, Levell J, Yoon T, Kohls D, Yowe D, Rigel DF, Imase H, Yuan J, Yasoshima K, DiPetrillo K, Monovich L, Xu L, Zhu M, Kato M, Jain M, Idamakanti N, Taslimi P, Kawanami T, Argikar UA, Kunjathoor V, Xie X, Yagi YI, Iwaki Y, Robinson Z, Park HM..  (2017)  Optimization of Allosteric With-No-Lysine (WNK) Kinase Inhibitors and Efficacy in Rodent Hypertension Models.,  60  (16): [PMID:28771350] [10.1021/acs.jmedchem.7b00708]

Source