4-(2-(Furan-2-yl)-1,2-dihydro-4-oxoquinazolin-3(4H)-yl)-N'-((furan-2-yl)methylene)butanehydrazide

ID: ALA4065811

PubChem CID: 137633169

Max Phase: Preclinical

Molecular Formula: C21H20N4O4

Molecular Weight: 392.42

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCCN1C(=O)c2ccccc2NC1c1ccco1)N/N=C/c1ccco1

Standard InChI:  InChI=1S/C21H20N4O4/c26-19(24-22-14-15-6-4-12-28-15)10-3-11-25-20(18-9-5-13-29-18)23-17-8-2-1-7-16(17)21(25)27/h1-2,4-9,12-14,20,23H,3,10-11H2,(H,24,26)/b22-14+

Standard InChI Key:  ARVRBMRIDIWTLJ-HYARGMPZSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    2.4378   -3.3760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4366   -4.1956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1447   -4.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1429   -2.9672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8515   -3.3724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8503   -4.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5565   -4.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2684   -4.1951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2696   -3.3744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5589   -2.9608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5543   -5.4193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9783   -2.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9750   -4.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9727   -5.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6793   -5.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3881   -5.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0947   -5.8374    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3904   -4.6096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0924   -6.6545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7990   -7.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7967   -7.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7242   -3.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2725   -2.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8656   -1.9920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0659   -2.1601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1379   -8.3628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3882   -9.1407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2055   -9.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4600   -8.3665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  7 11  2  0
  9 12  1  0
  8 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 12 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 12  1  0
 21 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4065811

    ---

Associated Targets(non-human)

Leishmania aethiopica (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 392.42Molecular Weight (Monoisotopic): 392.1485AlogP: 3.37#Rotatable Bonds: 7
Polar Surface Area: 100.08Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.33CX Basic pKa: CX LogP: 2.73CX LogD: 2.73
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.47Np Likeness Score: -1.49

References

1. Khattab SN, Haiba NS, Asal AM, Bekhit AA, Guemei AA, Amer A, El-Faham A..  (2017)  Study of antileishmanial activity of 2-aminobenzoyl amino acid hydrazides and their quinazoline derivatives.,  27  (4): [PMID:28087274] [10.1016/j.bmcl.2017.01.003]

Source